| General Information | |
|---|---|
| ZINC ID | ZINC000016569242 |
| Molecular Weight (Da) | 486 |
| SMILES | CCCCN(CC(=O)N1c2ccccc2-n2cccc2[C@H]1c1ccc(OC)cc1)C(=O)C1CCCC1 |
| Molecular Formula | C30N3O3 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 137.444 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| LogP | 5.686 |
| Activity (Ki) in nM | 602.56 |
| Polar Surface Area (PSA) | 54.78 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.06704866 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.4 |
| Ilogp | 4.63 |
| Xlogp3 | 5.27 |
| Wlogp | 5.04 |
| Mlogp | 3.43 |
| Silicos-it log p | 4.33 |
| Consensus log p | 4.54 |
| Esol log s | -5.86 |
| Esol solubility (mg/ml) | 0.00067 |
| Esol solubility (mol/l) | 0.00000138 |
| Esol class | Moderately |
| Ali log s | -6.17 |
| Ali solubility (mg/ml) | 0.000328 |
| Ali solubility (mol/l) | 0.00000067 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.56 |
| Silicos-it solubility (mg/ml) | 0.0000135 |
| Silicos-it solubility (mol/l) | 2.77E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.52 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.52 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.025 |
| Logd | 4.148 |
| Logp | 6.009 |
| F (20%) | 0.99 |
| F (30%) | 0.999 |
| Mdck | - |
| Ppb | 96.57% |
| Vdss | 0.49 |
| Fu | 1.32% |
| Cyp1a2-inh | 0.036 |
| Cyp1a2-sub | 0.882 |
| Cyp2c19-inh | 0.832 |
| Cyp2c19-sub | 0.928 |
| Cl | 2.813 |
| T12 | 0.114 |
| H-ht | 0.797 |
| Dili | 0.915 |
| Roa | 0.231 |
| Fdamdd | 0.962 |
| Skinsen | 0.172 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.048 |
| Bcf | 2.324 |
| Igc50 | 4.94 |
| Lc50 | 5.973 |
| Lc50dm | 4.175 |
| Nr-ar | 0.432 |
| Nr-ar-lbd | 0.164 |
| Nr-ahr | 0.156 |
| Nr-aromatase | 0.597 |
| Nr-er | 0.522 |
| Nr-er-lbd | 0.051 |
| Nr-ppar-gamma | 0.558 |
| Sr-are | 0.868 |
| Sr-atad5 | 0.013 |
| Sr-hse | 0.249 |
| Sr-mmp | 0.823 |
| Sr-p53 | 0.584 |
| Vol | 517.65 |
| Dense | 0.937 |
| Flex | 0.357 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 2 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.409 |
| Synth | 2.993 |
| Fsp3 | 0.4 |
| Mce-18 | 88.714 |
| Natural product-likeness | -1.06 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |