| General Information | |
|---|---|
| ZINC ID | ZINC000017654244 |
| Molecular Weight (Da) | 370 |
| SMILES | CCCCC/C=CC/C=CC/C=CC/C=CCCCC[P@](=O)(F)OC |
| Molecular Formula | C21F1O2P1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.924 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| LogP | 6.782 |
| Activity (Ki) in nM | 19.9526 |
| Polar Surface Area (PSA) | 36.11 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.799 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 0 |
| Fraction csp3 | 0.62 |
| Ilogp | 4.21 |
| Xlogp3 | 5.55 |
| Wlogp | 8.36 |
| Mlogp | 4.41 |
| Silicos-it log p | 4.78 |
| Consensus log p | 4.74 |
| Esol log s | -6.26 |
| Esol solubility (mg/ml) | 0.00025 |
| Esol solubility (mol/l) | 0.00000055 |
| Esol class | Poorly sol |
| Ali log s | -6.1 |
| Ali solubility (mg/ml) | 0.000356 |
| Ali solubility (mol/l) | 0.00000079 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.6 |
| Silicos-it solubility (mg/ml) | 0.0000113 |
| Silicos-it solubility (mol/l) | 0.00000002 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.1 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.76 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.03 |
| Logd | 2.542 |
| Logp | 2.274 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.60% |
| Vdss | 3.472 |
| Fu | 1.91% |
| Cyp1a2-inh | 0.196 |
| Cyp1a2-sub | 0.943 |
| Cyp2c19-inh | 0.435 |
| Cyp2c19-sub | 0.471 |
| Cl | 2.433 |
| T12 | 0.815 |
| H-ht | 0.38 |
| Dili | 0.01 |
| Roa | 0.018 |
| Fdamdd | 0.342 |
| Skinsen | 0.968 |
| Ec | 0.051 |
| Ei | 0.284 |
| Respiratory | 0.902 |
| Bcf | 1.239 |
| Igc50 | 5.329 |
| Lc50 | 2.903 |
| Lc50dm | 4.963 |
| Nr-ar | 0 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.004 |
| Nr-aromatase | 0.927 |
| Nr-er | 0.059 |
| Nr-er-lbd | 0.015 |
| Nr-ppar-gamma | 0.749 |
| Sr-are | 0.686 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.918 |
| Sr-mmp | 0.462 |
| Sr-p53 | 0.089 |
| Vol | 404.702 |
| Dense | 0.915 |
| Flex | 3.2 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 2 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.157 |
| Synth | 3.781 |
| Fsp3 | 0.619 |
| Mce-18 | 3 |
| Natural product-likeness | 0.698 |
| Alarm nmr | 0 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Accepted |
| Goldentriangle | Accepted |