| General Information | |
|---|---|
| ZINC ID | ZINC000026379103 |
| Molecular Weight (Da) | 461 |
| SMILES | COc1ccc2c(c1)c(CC(=O)N1CCOCC1)c(C)n2C(=O)c1c(Cl)cccc1Cl |
| Molecular Formula | C23Cl2N2O4 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.734 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| LogP | 4.282 |
| Activity (Ki) in nM | 58.884 |
| Polar Surface Area (PSA) | 60.77 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.957 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.3 |
| Ilogp | 3.63 |
| Xlogp3 | 4.46 |
| Wlogp | 3.97 |
| Mlogp | 3.42 |
| Silicos-it log p | 4.98 |
| Consensus log p | 4.09 |
| Esol log s | -5.47 |
| Esol solubility (mg/ml) | 0.00156 |
| Esol solubility (mol/l) | 0.00000337 |
| Esol class | Moderately |
| Ali log s | -5.46 |
| Ali solubility (mg/ml) | 0.00162 |
| Ali solubility (mol/l) | 0.0000035 |
| Ali class | Moderately |
| Silicos-it logsw | -7.07 |
| Silicos-it solubility (mg/ml) | 0.0000389 |
| Silicos-it solubility (mol/l) | 8.43E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.95 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.06 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.772 |
| Logd | 3.095 |
| Logp | 3.805 |
| F (20%) | 0.01 |
| F (30%) | 0.101 |
| Mdck | 2.69E-05 |
| Ppb | 0.9674 |
| Vdss | 0.908 |
| Fu | 0.0314 |
| Cyp1a2-inh | 0.375 |
| Cyp1a2-sub | 0.882 |
| Cyp2c19-inh | 0.895 |
| Cyp2c19-sub | 0.795 |
| Cl | 5.467 |
| T12 | 0.266 |
| H-ht | 0.687 |
| Dili | 0.874 |
| Roa | 0.911 |
| Fdamdd | 0.82 |
| Skinsen | 0.069 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.027 |
| Bcf | 2.024 |
| Igc50 | 4.086 |
| Lc50 | 5.448 |
| Lc50dm | 4.922 |
| Nr-ar | 0.142 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.796 |
| Nr-aromatase | 0.791 |
| Nr-er | 0.462 |
| Nr-er-lbd | 0.454 |
| Nr-ppar-gamma | 0.456 |
| Sr-are | 0.767 |
| Sr-atad5 | 0.108 |
| Sr-hse | 0.033 |
| Sr-mmp | 0.191 |
| Sr-p53 | 0.627 |
| Vol | 435.987 |
| Dense | 1.055 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 3 |
| Qed | 0.58 |
| Synth | 2.451 |
| Fsp3 | 0.304 |
| Mce-18 | 54.4 |
| Natural product-likeness | -1.163 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |