| General Information | |
|---|---|
| ZINC ID | ZINC000027519167 |
| Molecular Weight (Da) | 414 |
| SMILES | CC/C=CC/C=CC/C=CCCCCCCCC(=O)NCCc1ccc(O)c(O)c1 |
| Molecular Formula | C26N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.11 |
| HBA | 3 |
| HBD | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| LogP | 6.92 |
| Activity (Ki) in nM | 3162.28 |
| Polar Surface Area (PSA) | 69.56 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.867 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.5 |
| Ilogp | 3.73 |
| Xlogp3 | 5.12 |
| Wlogp | 6.35 |
| Mlogp | 4.25 |
| Silicos-it log p | 5.37 |
| Consensus log p | 4.58 |
| Esol log s | -5.72 |
| Esol solubility (mg/ml) | 0.000796 |
| Esol solubility (mol/l) | 0.00000191 |
| Esol class | Moderately |
| Ali log s | -5.59 |
| Ali solubility (mg/ml) | 0.00108 |
| Ali solubility (mol/l) | 0.00000258 |
| Ali class | Moderately |
| Silicos-it logsw | -7.45 |
| Silicos-it solubility (mg/ml) | 0.000015 |
| Silicos-it solubility (mol/l) | 3.59E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.21 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.91 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.772 |
| Logd | 3.62 |
| Logp | 3.232 |
| F (20%) | 1 |
| F (30%) | 1 |
| Mdck | - |
| Ppb | 99.78% |
| Vdss | 1.374 |
| Fu | 0.68% |
| Cyp1a2-inh | 0.344 |
| Cyp1a2-sub | 0.867 |
| Cyp2c19-inh | 0.83 |
| Cyp2c19-sub | 0.072 |
| Cl | 5.182 |
| T12 | 0.959 |
| H-ht | 0.197 |
| Dili | 0.025 |
| Roa | 0.01 |
| Fdamdd | 0.699 |
| Skinsen | 0.969 |
| Ec | 0.003 |
| Ei | 0.039 |
| Respiratory | 0.535 |
| Bcf | 0.964 |
| Igc50 | 5.354 |
| Lc50 | 2.618 |
| Lc50dm | 4.952 |
| Nr-ar | 0.004 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.259 |
| Nr-aromatase | 0.744 |
| Nr-er | 0.511 |
| Nr-er-lbd | 0.018 |
| Nr-ppar-gamma | 0.972 |
| Sr-are | 0.542 |
| Sr-atad5 | 0.149 |
| Sr-hse | 0.929 |
| Sr-mmp | 0.79 |
| Sr-p53 | 0.719 |
| Vol | 468.608 |
| Dense | 0.882 |
| Flex | 1.7 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 5 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.168 |
| Synth | 2.688 |
| Fsp3 | 0.5 |
| Mce-18 | 7 |
| Natural product-likeness | 0.813 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 1 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |