| General Information | |
|---|---|
| ZINC ID | ZINC000027715315 |
| Molecular Weight (Da) | 521 |
| SMILES | CN/C(=N/S(=O)(=O)c1ccc(C(F)(F)F)cc1)N1C[C@H](c2ccccc2)C(c2ccc(Cl)cc2)=N1 |
| Molecular Formula | C24Cl1F3N4O2S1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 128.815 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| LogP | 5.649 |
| Activity (Ki) in nM | 3548.134 |
| Polar Surface Area (PSA) | 82.51 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.962 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.17 |
| Ilogp | 4.58 |
| Xlogp3 | 5.62 |
| Wlogp | 6.6 |
| Mlogp | 4.6 |
| Silicos-it log p | 5.02 |
| Consensus log p | 5.28 |
| Esol log s | -6.53 |
| Esol solubility (mg/ml) | 0.000154 |
| Esol solubility (mol/l) | 0.00000029 |
| Esol class | Poorly sol |
| Ali log s | -7.12 |
| Ali solubility (mg/ml) | 0.0000399 |
| Ali solubility (mol/l) | 7.66E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.16 |
| Silicos-it solubility (mg/ml) | 0.00000036 |
| Silicos-it solubility (mol/l) | 6.95E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.49 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.55 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.969 |
| Logd | 2.667 |
| Logp | 4.695 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 2.52E-05 |
| Ppb | 0.989 |
| Vdss | 1.636 |
| Fu | 0.0247 |
| Cyp1a2-inh | 0.234 |
| Cyp1a2-sub | 0.906 |
| Cyp2c19-inh | 0.905 |
| Cyp2c19-sub | 0.94 |
| Cl | 0.665 |
| T12 | 0.015 |
| H-ht | 0.923 |
| Dili | 0.988 |
| Roa | 0.626 |
| Fdamdd | 0.756 |
| Skinsen | 0.04 |
| Ec | 0.003 |
| Ei | 0.005 |
| Respiratory | 0.899 |
| Bcf | 1.294 |
| Igc50 | 4.863 |
| Lc50 | 5.831 |
| Lc50dm | 5.914 |
| Nr-ar | 0.007 |
| Nr-ar-lbd | 0.21 |
| Nr-ahr | 0.135 |
| Nr-aromatase | 0.19 |
| Nr-er | 0.777 |
| Nr-er-lbd | 0.042 |
| Nr-ppar-gamma | 0.757 |
| Sr-are | 0.66 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.006 |
| Sr-mmp | 0.954 |
| Sr-p53 | 0.577 |
| Vol | 473.923 |
| Dense | 1.097 |
| Flex | 0.269 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 3 |
| Toxicophores | 1 |
| Qed | 0.383 |
| Synth | 3.135 |
| Fsp3 | 0.167 |
| Mce-18 | 84.857 |
| Natural product-likeness | -1.016 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 3 |
| Gsk | Rejected |
| Goldentriangle | Rejected |