| General Information | |
|---|---|
| ZINC ID | ZINC000027747826 |
| Molecular Weight (Da) | 353 |
| SMILES | CCCCCC#CCc1cc(O)c2c(c1)OC(C)(C)[C@H]1CC=C(C)C[C@H]21 |
| Molecular Formula | C24O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 103.787 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| LogP | 7.131 |
| Activity (Ki) in nM | 4.8978 |
| Polar Surface Area (PSA) | 29.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.866 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.58 |
| Ilogp | 4.55 |
| Xlogp3 | 8.1 |
| Wlogp | 6.21 |
| Mlogp | 4.95 |
| Silicos-it log p | 6.28 |
| Consensus log p | 6.02 |
| Esol log s | -7.04 |
| Esol solubility (mg/ml) | 0.0000325 |
| Esol solubility (mol/l) | 9.22E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.58 |
| Ali solubility (mg/ml) | 0.00000093 |
| Ali solubility (mol/l) | 2.66E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.39 |
| Silicos-it solubility (mg/ml) | 0.000142 |
| Silicos-it solubility (mol/l) | 0.0000004 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.7 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.67 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.912 |
| Logd | 4.983 |
| Logp | 7.874 |
| F (20%) | 0.998 |
| F (30%) | 0.992 |
| Mdck | - |
| Ppb | 98.48% |
| Vdss | 6.294 |
| Fu | 1.05% |
| Cyp1a2-inh | 0.29 |
| Cyp1a2-sub | 0.723 |
| Cyp2c19-inh | 0.928 |
| Cyp2c19-sub | 0.619 |
| Cl | 7.963 |
| T12 | 0.064 |
| H-ht | 0.877 |
| Dili | 0.339 |
| Roa | 0.088 |
| Fdamdd | 0.931 |
| Skinsen | 0.824 |
| Ec | 0.006 |
| Ei | 0.246 |
| Respiratory | 0.835 |
| Bcf | 2.838 |
| Igc50 | 5.036 |
| Lc50 | 5.814 |
| Lc50dm | 6.235 |
| Nr-ar | 0.041 |
| Nr-ar-lbd | 0.017 |
| Nr-ahr | 0.072 |
| Nr-aromatase | 0.177 |
| Nr-er | 0.364 |
| Nr-er-lbd | 0.66 |
| Nr-ppar-gamma | 0.537 |
| Sr-are | 0.82 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.182 |
| Sr-mmp | 0.944 |
| Sr-p53 | 0.188 |
| Vol | 399.752 |
| Dense | 0.881 |
| Flex | 0.235 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 4 |
| Qed | 0.401 |
| Synth | 3.788 |
| Fsp3 | 0.583 |
| Mce-18 | 62 |
| Natural product-likeness | 2.239 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |