| General Information | |
|---|---|
| ZINC ID | ZINC000027760010 |
| Molecular Weight (Da) | 386 |
| SMILES | CC1=CC[C@H]2[C@H](C1)c1c(O)cc(C/C=C/CCCC[N+](=O)[O-])cc1OC2(C)C |
| Molecular Formula | C23N1O4 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.018 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| LogP | 5.976 |
| Activity (Ki) in nM | 3.5481 |
| Polar Surface Area (PSA) | 72.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.709 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.57 |
| Ilogp | 3.81 |
| Xlogp3 | 6.7 |
| Wlogp | 5.55 |
| Mlogp | 3.39 |
| Silicos-it log p | 3.75 |
| Consensus log p | 4.64 |
| Esol log s | -6.15 |
| Esol solubility (mg/ml) | 0.000274 |
| Esol solubility (mol/l) | 0.00000071 |
| Esol class | Poorly sol |
| Ali log s | -8.08 |
| Ali solubility (mg/ml) | 0.00000317 |
| Ali solubility (mol/l) | 8.23E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.37 |
| Silicos-it solubility (mg/ml) | 0.00164 |
| Silicos-it solubility (mol/l) | 0.00000427 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.89 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 3 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.47 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -2.615 |
| Logd | 4.788 |
| Logp | 6.951 |
| F (20%) | 0.919 |
| F (30%) | 0.987 |
| Mdck | - |
| Ppb | 100.20% |
| Vdss | 3.455 |
| Fu | 0.77% |
| Cyp1a2-inh | 0.502 |
| Cyp1a2-sub | 0.635 |
| Cyp2c19-inh | 0.946 |
| Cyp2c19-sub | 0.409 |
| Cl | 3.269 |
| T12 | 0.161 |
| H-ht | 0.893 |
| Dili | 0.079 |
| Roa | 0.074 |
| Fdamdd | 0.907 |
| Skinsen | 0.925 |
| Ec | 0.003 |
| Ei | 0.028 |
| Respiratory | 0.937 |
| Bcf | 2.465 |
| Igc50 | 4.764 |
| Lc50 | 5.68 |
| Lc50dm | 6.3 |
| Nr-ar | 0.059 |
| Nr-ar-lbd | 0.049 |
| Nr-ahr | 0.038 |
| Nr-aromatase | 0.32 |
| Nr-er | 0.357 |
| Nr-er-lbd | 0.344 |
| Nr-ppar-gamma | 0.488 |
| Sr-are | 0.704 |
| Sr-atad5 | 0.01 |
| Sr-hse | 0.534 |
| Sr-mmp | 0.89 |
| Sr-p53 | 0.469 |
| Vol | 411.034 |
| Dense | 0.937 |
| Flex | 0.389 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.289 |
| Synth | 3.98 |
| Fsp3 | 0.565 |
| Mce-18 | 65.556 |
| Natural product-likeness | 2.37 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |