| General Information | |
|---|---|
| ZINC ID | ZINC000028333550 |
| Molecular Weight (Da) | 454 |
| SMILES | O=C(Nc1ccccc1)c1ccc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1 |
| Molecular Formula | C24Cl3N2O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.099 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 7.351 |
| Activity (Ki) in nM | 208.93 |
| Polar Surface Area (PSA) | 41.99 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.09789669 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0 |
| Ilogp | 4.28 |
| Xlogp3 | 7.19 |
| Wlogp | 7.44 |
| Mlogp | 5.29 |
| Silicos-it log p | 7.09 |
| Consensus log p | 6.26 |
| Esol log s | -7.44 |
| Esol solubility (mg/ml) | 0.0000163 |
| Esol solubility (mol/l) | 3.59E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.89 |
| Ali solubility (mg/ml) | 0.00000579 |
| Ali solubility (mol/l) | 1.28E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.29 |
| Silicos-it solubility (mg/ml) | 2.30E-09 |
| Silicos-it solubility (mol/l) | 5.07E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.96 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.626 |
| Logd | 4.188 |
| Logp | 6.85 |
| F (20%) | 0.448 |
| F (30%) | 0.716 |
| Mdck | - |
| Ppb | 101.67% |
| Vdss | 1.373 |
| Fu | 1.12% |
| Cyp1a2-inh | 0.793 |
| Cyp1a2-sub | 0.185 |
| Cyp2c19-inh | 0.79 |
| Cyp2c19-sub | 0.056 |
| Cl | 3.502 |
| T12 | 0.025 |
| H-ht | 0.291 |
| Dili | 0.965 |
| Roa | 0.387 |
| Fdamdd | 0.301 |
| Skinsen | 0.066 |
| Ec | 0.003 |
| Ei | 0.605 |
| Respiratory | 0.04 |
| Bcf | 4.073 |
| Igc50 | 5.445 |
| Lc50 | 6.98 |
| Lc50dm | 6.082 |
| Nr-ar | 0.243 |
| Nr-ar-lbd | 0.184 |
| Nr-ahr | 0.945 |
| Nr-aromatase | 0.867 |
| Nr-er | 0.799 |
| Nr-er-lbd | 0.797 |
| Nr-ppar-gamma | 0.95 |
| Sr-are | 0.942 |
| Sr-atad5 | 0.871 |
| Sr-hse | 0.564 |
| Sr-mmp | 0.964 |
| Sr-p53 | 0.96 |
| Vol | 431.577 |
| Dense | 1.047 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.345 |
| Synth | 1.996 |
| Fsp3 | 0 |
| Mce-18 | 22 |
| Natural product-likeness | -1.26 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |