| General Information | |
|---|---|
| ZINC ID | ZINC000028334252 |
| Molecular Weight (Da) | 450 |
| SMILES | CCCCOc1nc(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)cc1C(N)=O |
| Molecular Formula | C22Cl3N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.569 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| LogP | 6.963 |
| Activity (Ki) in nM | 32.3594 |
| Polar Surface Area (PSA) | 65.21 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.985 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.18 |
| Ilogp | 3.73 |
| Xlogp3 | 6.46 |
| Wlogp | 6.65 |
| Mlogp | 4.39 |
| Silicos-it log p | 6.82 |
| Consensus log p | 5.61 |
| Esol log s | -6.7 |
| Esol solubility (mg/ml) | 0.0000907 |
| Esol solubility (mol/l) | 0.0000002 |
| Esol class | Poorly sol |
| Ali log s | -7.62 |
| Ali solubility (mg/ml) | 0.0000107 |
| Ali solubility (mol/l) | 2.38E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.71 |
| Silicos-it solubility (mg/ml) | 8.69E-08 |
| Silicos-it solubility (mol/l) | 1.93E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.46 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.35 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.494 |
| Logd | 4.172 |
| Logp | 6.622 |
| F (20%) | 0.003 |
| F (30%) | 0.177 |
| Mdck | - |
| Ppb | 101.63% |
| Vdss | 0.654 |
| Fu | 0.97% |
| Cyp1a2-inh | 0.915 |
| Cyp1a2-sub | 0.246 |
| Cyp2c19-inh | 0.82 |
| Cyp2c19-sub | 0.06 |
| Cl | 5.567 |
| T12 | 0.012 |
| H-ht | 0.226 |
| Dili | 0.963 |
| Roa | 0.241 |
| Fdamdd | 0.1 |
| Skinsen | 0.021 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.025 |
| Bcf | 3.987 |
| Igc50 | 5.268 |
| Lc50 | 7.035 |
| Lc50dm | 6.199 |
| Nr-ar | 0.085 |
| Nr-ar-lbd | 0.062 |
| Nr-ahr | 0.946 |
| Nr-aromatase | 0.882 |
| Nr-er | 0.472 |
| Nr-er-lbd | 0.135 |
| Nr-ppar-gamma | 0.449 |
| Sr-are | 0.928 |
| Sr-atad5 | 0.372 |
| Sr-hse | 0.376 |
| Sr-mmp | 0.889 |
| Sr-p53 | 0.896 |
| Vol | 422.241 |
| Dense | 1.061 |
| Flex | 0.368 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.41 |
| Synth | 2.269 |
| Fsp3 | 0.182 |
| Mce-18 | 19 |
| Natural product-likeness | -0.905 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |