| General Information | |
|---|---|
| ZINC ID | ZINC000028339250 |
| Molecular Weight (Da) | 485 |
| SMILES | N#Cc1cc(-c2ccc(F)cc2)c(-c2ccc(Cl)cc2Cl)nc1OCc1ccc(F)c(F)c1 |
| Molecular Formula | C25Cl2F3N2O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.187 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| LogP | 8.078 |
| Activity (Ki) in nM | 7.2444 |
| Polar Surface Area (PSA) | 45.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.093 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.04 |
| Ilogp | 4.29 |
| Xlogp3 | 7.21 |
| Wlogp | 8.7 |
| Mlogp | 5.86 |
| Silicos-it log p | 8.54 |
| Consensus log p | 6.92 |
| Esol log s | -7.6 |
| Esol solubility (mg/ml) | 0.0000122 |
| Esol solubility (mol/l) | 2.52E-08 |
| Esol class | Poorly sol |
| Ali log s | -8 |
| Ali solubility (mg/ml) | 0.00000489 |
| Ali solubility (mol/l) | 1.01E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.71 |
| Silicos-it solubility (mg/ml) | 9.35E-10 |
| Silicos-it solubility (mol/l) | 1.93E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.14 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.46 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.741 |
| Logd | 4.392 |
| Logp | 6.844 |
| F (20%) | 0.001 |
| F (30%) | 0.024 |
| Mdck | - |
| Ppb | 104.76% |
| Vdss | 0.763 |
| Fu | 0.73% |
| Cyp1a2-inh | 0.726 |
| Cyp1a2-sub | 0.202 |
| Cyp2c19-inh | 0.692 |
| Cyp2c19-sub | 0.053 |
| Cl | 7.175 |
| T12 | 0.006 |
| H-ht | 0.697 |
| Dili | 0.938 |
| Roa | 0.094 |
| Fdamdd | 0.942 |
| Skinsen | 0.019 |
| Ec | 0.003 |
| Ei | 0.182 |
| Respiratory | 0.02 |
| Bcf | 3.686 |
| Igc50 | 5.479 |
| Lc50 | 7.775 |
| Lc50dm | 7.75 |
| Nr-ar | 0.065 |
| Nr-ar-lbd | 0.874 |
| Nr-ahr | 0.55 |
| Nr-aromatase | 0.839 |
| Nr-er | 0.313 |
| Nr-er-lbd | 0.286 |
| Nr-ppar-gamma | 0.534 |
| Sr-are | 0.822 |
| Sr-atad5 | 0.014 |
| Sr-hse | 0.205 |
| Sr-mmp | 0.861 |
| Sr-p53 | 0.93 |
| Vol | 449.228 |
| Dense | 1.077 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.293 |
| Synth | 2.436 |
| Fsp3 | 0.04 |
| Mce-18 | 24 |
| Natural product-likeness | -1.549 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |