| General Information | |
|---|---|
| ZINC ID | ZINC000028341759 |
| Molecular Weight (Da) | 548 |
| SMILES | CCNC(=O)c1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)nc1OCc1ccc(F)c(F)c1 |
| Molecular Formula | C27Cl3F2N2O2 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 138.263 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| LogP | 8.215 |
| Activity (Ki) in nM | 812.831 |
| Polar Surface Area (PSA) | 51.22 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.977 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.11 |
| Ilogp | 4.8 |
| Xlogp3 | 7.67 |
| Wlogp | 8.67 |
| Mlogp | 6.16 |
| Silicos-it log p | 8.81 |
| Consensus log p | 7.22 |
| Esol log s | -8.03 |
| Esol solubility (mg/ml) | 0.00000507 |
| Esol solubility (mol/l) | 9.25E-09 |
| Esol class | Poorly sol |
| Ali log s | -8.59 |
| Ali solubility (mg/ml) | 0.00000142 |
| Ali solubility (mol/l) | 2.59E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -12.69 |
| Silicos-it solubility (mg/ml) | 1.13E-10 |
| Silicos-it solubility (mol/l) | 2.07E-13 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.2 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.63 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.471 |
| Logd | 4.074 |
| Logp | 7.141 |
| F (20%) | 0.001 |
| F (30%) | 0.032 |
| Mdck | 7.65E-06 |
| Ppb | 1.0293 |
| Vdss | 1.255 |
| Fu | 0.0113 |
| Cyp1a2-inh | 0.651 |
| Cyp1a2-sub | 0.278 |
| Cyp2c19-inh | 0.823 |
| Cyp2c19-sub | 0.056 |
| Cl | 5.508 |
| T12 | 0.009 |
| H-ht | 0.613 |
| Dili | 0.923 |
| Roa | 0.12 |
| Fdamdd | 0.849 |
| Skinsen | 0.019 |
| Ec | 0.003 |
| Ei | 0.013 |
| Respiratory | 0.034 |
| Bcf | 3.71 |
| Igc50 | 5.445 |
| Lc50 | 7.673 |
| Lc50dm | 7.296 |
| Nr-ar | 0.034 |
| Nr-ar-lbd | 0.112 |
| Nr-ahr | 0.871 |
| Nr-aromatase | 0.899 |
| Nr-er | 0.361 |
| Nr-er-lbd | 0.016 |
| Nr-ppar-gamma | 0.583 |
| Sr-are | 0.892 |
| Sr-atad5 | 0.206 |
| Sr-hse | 0.283 |
| Sr-mmp | 0.902 |
| Sr-p53 | 0.91 |
| Vol | 504.391 |
| Dense | 1.083 |
| Flex | 0.32 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.255 |
| Synth | 2.446 |
| Fsp3 | 0.111 |
| Mce-18 | 25 |
| Natural product-likeness | -1.382 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |