| General Information | |
|---|---|
| ZINC ID | ZINC000028342315 |
| Molecular Weight (Da) | 599 |
| SMILES | COc1ccc(S(=O)(=O)c2cc(OC)ccc2S(=O)(=O)c2ccc([C@H](C)NC(=O)Nc3ccc(F)cc3)cc2)cc1 |
| Molecular Formula | C29F1N2O7S2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 153.732 |
| HBA | 7 |
| HBD | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| LogP | 5.952 |
| Activity (Ki) in nM | 1778.28 |
| Polar Surface Area (PSA) | 144.63 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.05098474 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.14 |
| Ilogp | 3.89 |
| Xlogp3 | 4.46 |
| Wlogp | 7.46 |
| Mlogp | 4.29 |
| Silicos-it log p | 3.87 |
| Consensus log p | 4.79 |
| Esol log s | -6.07 |
| Esol solubility (mg/ml) | 0.000511 |
| Esol solubility (mol/l) | 0.00000085 |
| Esol class | Poorly sol |
| Ali log s | -7.22 |
| Ali solubility (mg/ml) | 0.0000364 |
| Ali solubility (mol/l) | 6.07E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.52 |
| Silicos-it solubility (mg/ml) | 0.00000001 |
| Silicos-it solubility (mol/l) | 3.01E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.79 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 2 |
| Egan number of violations | 2 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.19 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.549 |
| Logd | 3.316 |
| Logp | 4.747 |
| F (20%) | 0.001 |
| F (30%) | 0.01 |
| Mdck | - |
| Ppb | 99.62% |
| Vdss | 0.469 |
| Fu | 0.91% |
| Cyp1a2-inh | 0.107 |
| Cyp1a2-sub | 0.917 |
| Cyp2c19-inh | 0.809 |
| Cyp2c19-sub | 0.934 |
| Cl | 0.807 |
| T12 | 0.015 |
| H-ht | 0.945 |
| Dili | 0.998 |
| Roa | 0.013 |
| Fdamdd | 0.98 |
| Skinsen | 0.026 |
| Ec | 0.003 |
| Ei | 0.007 |
| Respiratory | 0.001 |
| Bcf | 0.335 |
| Igc50 | 4.531 |
| Lc50 | 3.931 |
| Lc50dm | 6.388 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.023 |
| Nr-ahr | 0.136 |
| Nr-aromatase | 0.024 |
| Nr-er | 0.371 |
| Nr-er-lbd | 0.011 |
| Nr-ppar-gamma | 0.005 |
| Sr-are | 0.741 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.001 |
| Sr-mmp | 0.831 |
| Sr-p53 | 0.003 |
| Vol | 568.251 |
| Dense | 1.053 |
| Flex | 0.379 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 5 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.264 |
| Synth | 2.844 |
| Fsp3 | 0.138 |
| Mce-18 | 58 |
| Natural product-likeness | -1.335 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |