| General Information | |
|---|---|
| ZINC ID | ZINC000028526413 |
| Molecular Weight (Da) | 514 |
| SMILES | C[C@H](NS(C)(=O)=O)c1ccc(S(=O)(=O)c2ccccc2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| Molecular Formula | C21Cl1N1O6S3 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 124.235 |
| HBA | 6 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 3.995 |
| Activity (Ki) in nM | 57.544 |
| Polar Surface Area (PSA) | 139.59 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | - |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.95764386 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.14 |
| Ilogp | 2.11 |
| Xlogp3 | 3.44 |
| Wlogp | 6.53 |
| Mlogp | 3.25 |
| Silicos-it log p | 2.54 |
| Consensus log p | 3.58 |
| Esol log s | -5.15 |
| Esol solubility (mg/ml) | 3.65E-03 |
| Esol solubility (mol/l) | 7.10E-06 |
| Esol class | Moderately |
| Ali log s | -6.05 |
| Ali solubility (mg/ml) | 4.56E-04 |
| Ali solubility (mol/l) | 8.87E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.5 |
| Silicos-it solubility (mg/ml) | 1.61E-06 |
| Silicos-it solubility (mol/l) | 3.14E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.99 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 2 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.57 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.721 |
| Logd | 2.759 |
| Logp | 3.394 |
| F (20%) | 0.001 |
| F (30%) | 0.002 |
| Mdck | 2.30E-05 |
| Ppb | 0.9741 |
| Vdss | 0.289 |
| Fu | 0.0161 |
| Cyp1a2-inh | 0.147 |
| Cyp1a2-sub | 0.336 |
| Cyp2c19-inh | 0.539 |
| Cyp2c19-sub | 0.918 |
| Cl | 0.967 |
| T12 | 0.017 |
| H-ht | 0.97 |
| Dili | 0.999 |
| Roa | 0.039 |
| Fdamdd | 0.985 |
| Skinsen | 0.029 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.002 |
| Bcf | 0.137 |
| Igc50 | 3.464 |
| Lc50 | 3.567 |
| Lc50dm | 4.531 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.019 |
| Nr-ahr | 0.04 |
| Nr-aromatase | 0.015 |
| Nr-er | 0.091 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.377 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.001 |
| Sr-mmp | 0.834 |
| Sr-p53 | 0.001 |
| Vol | 456.851 |
| Dense | 1.123 |
| Flex | 24 |
| Nstereo | 0.292 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 1 |
| Synth | 0.516 |
| Fsp3 | 2.753 |
| Mce-18 | 0.143 |
| Natural product-likeness | 50 |
| Alarm nmr | -1.14 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |