| General Information | |
|---|---|
| ZINC ID | ZINC000028528758 |
| Molecular Weight (Da) | 598 |
| SMILES | C[C@H](NS(C)(=O)=O)c1ccc(Cc2ccc(OC(F)(F)F)cc2S(=O)(=O)c2ccccc2OC(F)(F)F)cc1 |
| Molecular Formula | C24F6N1O6S2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 130.784 |
| HBA | 6 |
| HBD | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| LogP | 8.443 |
| Activity (Ki) in nM | 15.849 |
| Polar Surface Area (PSA) | 115.53 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | + |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.10852611 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.25 |
| Ilogp | 3.51 |
| Xlogp3 | 6.3 |
| Wlogp | 9.88 |
| Mlogp | 3.34 |
| Silicos-it log p | 4.78 |
| Consensus log p | 5.56 |
| Esol log s | -7.13 |
| Esol solubility (mg/ml) | 4.44E-05 |
| Esol solubility (mol/l) | 7.42E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.51 |
| Ali solubility (mg/ml) | 1.83E-06 |
| Ali solubility (mol/l) | 3.06E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.52 |
| Silicos-it solubility (mg/ml) | 1.82E-07 |
| Silicos-it solubility (mol/l) | 3.05E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.47 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 1 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 4.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.864 |
| Logd | 3.881 |
| Logp | 5.923 |
| F (20%) | 0.003 |
| F (30%) | 0.013 |
| Mdck | 2.72E-05 |
| Ppb | 1.0086 |
| Vdss | 0.75 |
| Fu | 0.0089 |
| Cyp1a2-inh | 0.143 |
| Cyp1a2-sub | 0.737 |
| Cyp2c19-inh | 0.777 |
| Cyp2c19-sub | 0.285 |
| Cl | 4.558 |
| T12 | 0.034 |
| H-ht | 0.999 |
| Dili | 0.997 |
| Roa | 0.832 |
| Fdamdd | 0.993 |
| Skinsen | 0.011 |
| Ec | 0.003 |
| Ei | 0.006 |
| Respiratory | 0.666 |
| Bcf | 1.079 |
| Igc50 | 4.293 |
| Lc50 | 5.118 |
| Lc50dm | 5.614 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.043 |
| Nr-ahr | 0.139 |
| Nr-aromatase | 0.353 |
| Nr-er | 0.08 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.172 |
| Sr-are | 0.489 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.004 |
| Sr-mmp | 0.516 |
| Sr-p53 | 0.009 |
| Vol | 511.424 |
| Dense | 1.167 |
| Flex | 22 |
| Nstereo | 0.5 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 1 |
| Synth | 0.327 |
| Fsp3 | 3.22 |
| Mce-18 | 0.25 |
| Natural product-likeness | 58 |
| Alarm nmr | -0.932 |
| Bms | 3 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |