| General Information | |
|---|---|
| ZINC ID | ZINC000028567948 |
| Molecular Weight (Da) | 545 |
| SMILES | CC(=O)Nc1c(C(C)=O)c(=O)n(CCO)c2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc12 |
| Molecular Formula | C26Cl3N3O4 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 140.37 |
| HBA | 5 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| LogP | 5.296 |
| Activity (Ki) in nM | 1513.561 |
| Polar Surface Area (PSA) | 101.29 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.943 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.15 |
| Ilogp | 3.41 |
| Xlogp3 | 4.61 |
| Wlogp | 5.65 |
| Mlogp | 3.51 |
| Silicos-it log p | 6.41 |
| Consensus log p | 4.72 |
| Esol log s | -6.11 |
| Esol solubility (mg/ml) | 0.000421 |
| Esol solubility (mol/l) | 0.00000077 |
| Esol class | Poorly sol |
| Ali log s | -6.46 |
| Ali solubility (mg/ml) | 0.000188 |
| Ali solubility (mol/l) | 0.00000034 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.02 |
| Silicos-it solubility (mg/ml) | 5.21E-08 |
| Silicos-it solubility (mol/l) | 9.57E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.35 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.6 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.242 |
| Logd | 2.811 |
| Logp | 4.76 |
| F (20%) | 0.006 |
| F (30%) | 0.99 |
| Mdck | 1.26E-05 |
| Ppb | 0.9924 |
| Vdss | 0.843 |
| Fu | 0.0086 |
| Cyp1a2-inh | 0.621 |
| Cyp1a2-sub | 0.303 |
| Cyp2c19-inh | 0.83 |
| Cyp2c19-sub | 0.068 |
| Cl | 1.623 |
| T12 | 0.096 |
| H-ht | 0.974 |
| Dili | 0.977 |
| Roa | 0.023 |
| Fdamdd | 0.041 |
| Skinsen | 0.091 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.79 |
| Bcf | 1.985 |
| Igc50 | 4.628 |
| Lc50 | 6.357 |
| Lc50dm | 5.659 |
| Nr-ar | 0.016 |
| Nr-ar-lbd | 0.564 |
| Nr-ahr | 0.925 |
| Nr-aromatase | 0.356 |
| Nr-er | 0.203 |
| Nr-er-lbd | 0.014 |
| Nr-ppar-gamma | 0.919 |
| Sr-are | 0.784 |
| Sr-atad5 | 0.215 |
| Sr-hse | 0.792 |
| Sr-mmp | 0.862 |
| Sr-p53 | 0.96 |
| Vol | 503.537 |
| Dense | 1.078 |
| Flex | 0.269 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 5 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.297 |
| Synth | 2.7 |
| Fsp3 | 0.154 |
| Mce-18 | 27 |
| Natural product-likeness | -0.906 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |