| General Information | |
|---|---|
| ZINC ID | ZINC000028568053 |
| Molecular Weight (Da) | 531 |
| SMILES | CC(=O)c1c(NC(=O)CO)c2cc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3Cl)nc2n(C)c1=O |
| Molecular Formula | C25Cl3N3O4 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 135.78 |
| HBA | 5 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| LogP | 5.163 |
| Activity (Ki) in nM | 3630.781 |
| Polar Surface Area (PSA) | 101.29 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.12 |
| Ilogp | 3.53 |
| Xlogp3 | 4.64 |
| Wlogp | 5.17 |
| Mlogp | 3.58 |
| Silicos-it log p | 6 |
| Consensus log p | 4.59 |
| Esol log s | -6.12 |
| Esol solubility (mg/ml) | 0.0004 |
| Esol solubility (mol/l) | 0.00000075 |
| Esol class | Poorly sol |
| Ali log s | -6.49 |
| Ali solubility (mg/ml) | 0.00017 |
| Ali solubility (mol/l) | 0.00000032 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.63 |
| Silicos-it solubility (mg/ml) | 0.00000012 |
| Silicos-it solubility (mol/l) | 2.34E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.24 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.43 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.735 |
| Logd | 3.112 |
| Logp | 4.958 |
| F (20%) | 0.002 |
| F (30%) | 0.01 |
| Mdck | 1.57E-05 |
| Ppb | 1.0013 |
| Vdss | 0.58 |
| Fu | 0.0068 |
| Cyp1a2-inh | 0.592 |
| Cyp1a2-sub | 0.299 |
| Cyp2c19-inh | 0.801 |
| Cyp2c19-sub | 0.067 |
| Cl | 2.398 |
| T12 | 0.152 |
| H-ht | 0.787 |
| Dili | 0.962 |
| Roa | 0.048 |
| Fdamdd | 0.087 |
| Skinsen | 0.296 |
| Ec | 0.003 |
| Ei | 0.07 |
| Respiratory | 0.646 |
| Bcf | 1.859 |
| Igc50 | 4.924 |
| Lc50 | 6.277 |
| Lc50dm | 5.72 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.427 |
| Nr-ahr | 0.936 |
| Nr-aromatase | 0.321 |
| Nr-er | 0.205 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.891 |
| Sr-are | 0.624 |
| Sr-atad5 | 0.025 |
| Sr-hse | 0.204 |
| Sr-mmp | 0.854 |
| Sr-p53 | 0.931 |
| Vol | 486.241 |
| Dense | 1.088 |
| Flex | 0.231 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 5 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.338 |
| Synth | 2.682 |
| Fsp3 | 0.12 |
| Mce-18 | 27 |
| Natural product-likeness | -0.8 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |