| General Information | |
|---|---|
| ZINC ID | ZINC000028569434 |
| Molecular Weight (Da) | 559 |
| SMILES | COCCn1c(=O)c(C(C)=O)c(NC(C)=O)c2cc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3Cl)nc21 |
| Molecular Formula | C27Cl3N3O4 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 145.122 |
| HBA | 5 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| LogP | 5.704 |
| Activity (Ki) in nM | 1819.701 |
| Polar Surface Area (PSA) | 90.29 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.915 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 22 |
| Fraction csp3 | 0.19 |
| Ilogp | 3.37 |
| Xlogp3 | 5.14 |
| Wlogp | 6.31 |
| Mlogp | 3.56 |
| Silicos-it log p | 6.96 |
| Consensus log p | 5.07 |
| Esol log s | -6.46 |
| Esol solubility (mg/ml) | 0.000196 |
| Esol solubility (mol/l) | 0.00000035 |
| Esol class | Poorly sol |
| Ali log s | -6.78 |
| Ali solubility (mg/ml) | 0.0000925 |
| Ali solubility (mol/l) | 0.00000016 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.7 |
| Silicos-it solubility (mg/ml) | 0.00000001 |
| Silicos-it solubility (mol/l) | 1.98E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.06 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.74 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.978 |
| Logd | 3.415 |
| Logp | 5.155 |
| F (20%) | 0.003 |
| F (30%) | 0.419 |
| Mdck | 1.33E-05 |
| Ppb | 0.9967 |
| Vdss | 0.823 |
| Fu | 0.0103 |
| Cyp1a2-inh | 0.5 |
| Cyp1a2-sub | 0.846 |
| Cyp2c19-inh | 0.777 |
| Cyp2c19-sub | 0.071 |
| Cl | 1.959 |
| T12 | 0.056 |
| H-ht | 0.967 |
| Dili | 0.975 |
| Roa | 0.036 |
| Fdamdd | 0.049 |
| Skinsen | 0.109 |
| Ec | 0.003 |
| Ei | 0.008 |
| Respiratory | 0.544 |
| Bcf | 2.172 |
| Igc50 | 4.71 |
| Lc50 | 6.433 |
| Lc50dm | 6.303 |
| Nr-ar | 0.023 |
| Nr-ar-lbd | 0.589 |
| Nr-ahr | 0.936 |
| Nr-aromatase | 0.661 |
| Nr-er | 0.293 |
| Nr-er-lbd | 0.037 |
| Nr-ppar-gamma | 0.934 |
| Sr-are | 0.866 |
| Sr-atad5 | 0.181 |
| Sr-hse | 0.844 |
| Sr-mmp | 0.874 |
| Sr-p53 | 0.963 |
| Vol | 520.833 |
| Dense | 1.07 |
| Flex | 0.308 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 0 |
| Nonbiodegradable | 3 |
| Skin sensitization | 5 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 0.262 |
| Synth | 2.694 |
| Fsp3 | 0.185 |
| Mce-18 | 27 |
| Natural product-likeness | -1.099 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |