| General Information | |
|---|---|
| ZINC ID | ZINC000028572054 |
| Molecular Weight (Da) | 337 |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(C2(C#N)CCCC2)cc1O |
| Molecular Formula | C22N1O2 |
| Action | Partial Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.936 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| LogP | 5.586 |
| Activity (Ki) in nM | 104.713 |
| Polar Surface Area (PSA) | 64.25 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94698917 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.5 |
| Ilogp | 3.5 |
| Xlogp3 | 5.18 |
| Wlogp | 5.45 |
| Mlogp | 3.56 |
| Silicos-it log p | 4.85 |
| Consensus log p | 4.51 |
| Esol log s | -5.18 |
| Esol solubility (mg/ml) | 0.00225 |
| Esol solubility (mol/l) | 0.00000668 |
| Esol class | Moderately |
| Ali log s | -6.28 |
| Ali solubility (mg/ml) | 0.000179 |
| Ali solubility (mol/l) | 0.00000053 |
| Ali class | Poorly sol |
| Silicos-it logsw | -4.86 |
| Silicos-it solubility (mg/ml) | 0.00469 |
| Silicos-it solubility (mol/l) | 0.0000139 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.68 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.95 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.35 |
| Logd | 3.969 |
| Logp | 5.449 |
| F (20%) | 0.964 |
| F (30%) | 0.258 |
| Mdck | 1.87E-05 |
| Ppb | 0.9801 |
| Vdss | 5.053 |
| Fu | 0.011 |
| Cyp1a2-inh | 0.708 |
| Cyp1a2-sub | 0.942 |
| Cyp2c19-inh | 0.888 |
| Cyp2c19-sub | 0.337 |
| Cl | 2.72 |
| T12 | 0.165 |
| H-ht | 0.26 |
| Dili | 0.131 |
| Roa | 0.812 |
| Fdamdd | 0.969 |
| Skinsen | 0.08 |
| Ec | 0.006 |
| Ei | 0.687 |
| Respiratory | 0.976 |
| Bcf | 1.736 |
| Igc50 | 4.894 |
| Lc50 | 6.9 |
| Lc50dm | 6.845 |
| Nr-ar | 0.072 |
| Nr-ar-lbd | 0.818 |
| Nr-ahr | 0.784 |
| Nr-aromatase | 0.862 |
| Nr-er | 0.923 |
| Nr-er-lbd | 0.876 |
| Nr-ppar-gamma | 0.896 |
| Sr-are | 0.896 |
| Sr-atad5 | 0.024 |
| Sr-hse | 0.925 |
| Sr-mmp | 0.981 |
| Sr-p53 | 0.97 |
| Vol | 373.521 |
| Dense | 0.903 |
| Flex | 0.158 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.721 |
| Synth | 3.943 |
| Fsp3 | 0.5 |
| Mce-18 | 70.909 |
| Natural product-likeness | 1.591 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |