| General Information | |
|---|---|
| ZINC ID | ZINC000028645232 |
| Molecular Weight (Da) | 402 |
| SMILES | COc1cccc(Nc2ncc(C(=O)NCc3ccccc3)c(C(F)(F)F)n2)c1 |
| Molecular Formula | C20F3N4O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 101.309 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| LogP | 4.268 |
| Activity (Ki) in nM | 467.735 |
| Polar Surface Area (PSA) | 76.14 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.09331464 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.15 |
| Ilogp | 2.95 |
| Xlogp3 | 3.74 |
| Wlogp | 5.18 |
| Mlogp | 2.41 |
| Silicos-it log p | 3.78 |
| Consensus log p | 3.61 |
| Esol log s | -4.62 |
| Esol solubility (mg/ml) | 9.60E-03 |
| Esol solubility (mol/l) | 2.39E-05 |
| Esol class | Moderately |
| Ali log s | -5.03 |
| Ali solubility (mg/ml) | 3.75E-03 |
| Ali solubility (mol/l) | 9.31E-06 |
| Ali class | Moderately |
| Silicos-it logsw | -8.08 |
| Silicos-it solubility (mg/ml) | 3.37E-06 |
| Silicos-it solubility (mol/l) | 8.38E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.1 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 2.76 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.544 |
| Logd | 3.741 |
| Logp | 3.808 |
| F (20%) | 0.002 |
| F (30%) | 0.009 |
| Mdck | 1.81E-05 |
| Ppb | 0.9773 |
| Vdss | 1.266 |
| Fu | 0.0158 |
| Cyp1a2-inh | 0.823 |
| Cyp1a2-sub | 0.775 |
| Cyp2c19-inh | 0.95 |
| Cyp2c19-sub | 0.082 |
| Cl | 5.355 |
| T12 | 0.488 |
| H-ht | 0.986 |
| Dili | 0.873 |
| Roa | 0.606 |
| Fdamdd | 0.94 |
| Skinsen | 0.607 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.914 |
| Bcf | 0.962 |
| Igc50 | 3.514 |
| Lc50 | 4.868 |
| Lc50dm | 6.662 |
| Nr-ar | 0.509 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.915 |
| Nr-aromatase | 0.886 |
| Nr-er | 0.34 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.019 |
| Sr-are | 0.338 |
| Sr-atad5 | 0.18 |
| Sr-hse | 0.008 |
| Sr-mmp | 0.493 |
| Sr-p53 | 0.349 |
| Vol | 382.212 |
| Dense | 1.052 |
| Flex | 20 |
| Nstereo | 0.35 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 1 |
| Synth | 0.685 |
| Fsp3 | 2.669 |
| Mce-18 | 0.15 |
| Natural product-likeness | 19 |
| Alarm nmr | -1.323 |
| Bms | 2 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Accepted |
| Goldentriangle | Rejected |