| General Information | |
|---|---|
| ZINC ID | ZINC000028645383 |
| Molecular Weight (Da) | 416 |
| SMILES | O=C(NCC1CCOCC1)c1cnc(Nc2cc(F)cc(F)c2)nc1C(F)(F)F |
| Molecular Formula | C18F5N4O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 93.959 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| LogP | 3.532 |
| Activity (Ki) in nM | 125.893 |
| Polar Surface Area (PSA) | 76.14 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.72796547 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.39 |
| Ilogp | 2.95 |
| Xlogp3 | 3.07 |
| Wlogp | 5.67 |
| Mlogp | 2.68 |
| Silicos-it log p | 4.05 |
| Consensus log p | 3.68 |
| Esol log s | -4.2 |
| Esol solubility (mg/ml) | 2.63E-02 |
| Esol solubility (mol/l) | 6.31E-05 |
| Esol class | Moderately |
| Ali log s | -4.34 |
| Ali solubility (mg/ml) | 1.92E-02 |
| Ali solubility (mol/l) | 4.61E-05 |
| Ali class | Moderately |
| Silicos-it logsw | -6.88 |
| Silicos-it solubility (mg/ml) | 5.53E-05 |
| Silicos-it solubility (mol/l) | 1.33E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.66 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.86 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.428 |
| Logd | 3.451 |
| Logp | 3.327 |
| F (20%) | 0.002 |
| F (30%) | 0.002 |
| Mdck | 1.62E-05 |
| Ppb | 0.9617 |
| Vdss | 0.726 |
| Fu | 0.0328 |
| Cyp1a2-inh | 0.377 |
| Cyp1a2-sub | 0.725 |
| Cyp2c19-inh | 0.845 |
| Cyp2c19-sub | 0.057 |
| Cl | 5.282 |
| T12 | 0.148 |
| H-ht | 0.992 |
| Dili | 0.177 |
| Roa | 0.69 |
| Fdamdd | 0.956 |
| Skinsen | 0.375 |
| Ec | 0.003 |
| Ei | 0.011 |
| Respiratory | 0.915 |
| Bcf | 1.682 |
| Igc50 | 2.722 |
| Lc50 | 4.014 |
| Lc50dm | 7.008 |
| Nr-ar | 0.003 |
| Nr-ar-lbd | 0.002 |
| Nr-ahr | 0.873 |
| Nr-aromatase | 0.825 |
| Nr-er | 0.168 |
| Nr-er-lbd | 0.006 |
| Nr-ppar-gamma | 0.312 |
| Sr-are | 0.545 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.014 |
| Sr-mmp | 0.363 |
| Sr-p53 | 0.376 |
| Vol | 367.665 |
| Dense | 1.132 |
| Flex | 20 |
| Nstereo | 0.3 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 3 |
| Qed | 1 |
| Synth | 0.752 |
| Fsp3 | 3.163 |
| Mce-18 | 0.389 |
| Natural product-likeness | 48 |
| Alarm nmr | -1.203 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Accepted |
| Goldentriangle | Rejected |