| General Information | |
|---|---|
| ZINC ID | ZINC000028649230 |
| Molecular Weight (Da) | 376 |
| SMILES | CCCCCCc1ccc(OCCCCCCCC(=O)NC2CC2)cc1O |
| Molecular Formula | C23N1O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 110.133 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| LogP | 6.257 |
| Activity (Ki) in nM | 56.2341 |
| Polar Surface Area (PSA) | 58.56 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.063 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.7 |
| Ilogp | 4.63 |
| Xlogp3 | 6.46 |
| Wlogp | 5.45 |
| Mlogp | 3.5 |
| Silicos-it log p | 6.22 |
| Consensus log p | 5.25 |
| Esol log s | -5.35 |
| Esol solubility (mg/ml) | 0.00169 |
| Esol solubility (mol/l) | 0.0000045 |
| Esol class | Moderately |
| Ali log s | -7.48 |
| Ali solubility (mg/ml) | 0.0000123 |
| Ali solubility (mol/l) | 3.28E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.35 |
| Silicos-it solubility (mg/ml) | 0.0000168 |
| Silicos-it solubility (mol/l) | 4.48E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 1 |
| Egan number of violations | 0 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.06 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.315 |
| Logd | 4.419 |
| Logp | 6.203 |
| F (20%) | 0.978 |
| F (30%) | 0.999 |
| Mdck | - |
| Ppb | 97.85% |
| Vdss | 0.999 |
| Fu | 1.11% |
| Cyp1a2-inh | 0.378 |
| Cyp1a2-sub | 0.462 |
| Cyp2c19-inh | 0.744 |
| Cyp2c19-sub | 0.101 |
| Cl | 7.444 |
| T12 | 0.333 |
| H-ht | 0.365 |
| Dili | 0.059 |
| Roa | 0.457 |
| Fdamdd | 0.168 |
| Skinsen | 0.942 |
| Ec | 0.003 |
| Ei | 0.04 |
| Respiratory | 0.233 |
| Bcf | 0.99 |
| Igc50 | 5.171 |
| Lc50 | 4.703 |
| Lc50dm | 5.344 |
| Nr-ar | 0.294 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.716 |
| Nr-aromatase | 0.726 |
| Nr-er | 0.505 |
| Nr-er-lbd | 0.018 |
| Nr-ppar-gamma | 0.954 |
| Sr-are | 0.679 |
| Sr-atad5 | 0.058 |
| Sr-hse | 0.665 |
| Sr-mmp | 0.932 |
| Sr-p53 | 0.536 |
| Vol | 416.073 |
| Dense | 0.902 |
| Flex | 1.6 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.397 |
| Synth | 2.12 |
| Fsp3 | 0.696 |
| Mce-18 | 23.692 |
| Natural product-likeness | -0.248 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |