| General Information | |
|---|---|
| ZINC ID | ZINC000028702496 |
| Molecular Weight (Da) | 465 |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cn(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)n1 |
| Molecular Formula | C22Cl3N3O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.26 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 5.764 |
| Activity (Ki) in nM | 1096.478 |
| Polar Surface Area (PSA) | 67.15 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.983 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 17 |
| Fraction csp3 | 0.27 |
| Ilogp | 4.2 |
| Xlogp3 | 5.48 |
| Wlogp | 5.53 |
| Mlogp | 4.13 |
| Silicos-it log p | 4.77 |
| Consensus log p | 4.82 |
| Esol log s | -6.26 |
| Esol solubility (mg/ml) | 0.000253 |
| Esol solubility (mol/l) | 0.00000054 |
| Esol class | Poorly sol |
| Ali log s | -6.65 |
| Ali solubility (mg/ml) | 0.000105 |
| Ali solubility (mol/l) | 0.00000022 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.78 |
| Silicos-it solubility (mg/ml) | 0.00000766 |
| Silicos-it solubility (mol/l) | 1.65E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.24 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.84 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.066 |
| Logd | 4.012 |
| Logp | 5.874 |
| F (20%) | 0.002 |
| F (30%) | 0.546 |
| Mdck | 5.85E-06 |
| Ppb | 0.9842 |
| Vdss | 0.685 |
| Fu | 0.0155 |
| Cyp1a2-inh | 0.703 |
| Cyp1a2-sub | 0.135 |
| Cyp2c19-inh | 0.874 |
| Cyp2c19-sub | 0.076 |
| Cl | 1.505 |
| T12 | 0.036 |
| H-ht | 0.437 |
| Dili | 0.936 |
| Roa | 0.535 |
| Fdamdd | 0.919 |
| Skinsen | 0.067 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.1 |
| Bcf | 2.22 |
| Igc50 | 4.858 |
| Lc50 | 5.617 |
| Lc50dm | 5.484 |
| Nr-ar | 0.273 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.532 |
| Nr-aromatase | 0.788 |
| Nr-er | 0.454 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.281 |
| Sr-are | 0.557 |
| Sr-atad5 | 0.149 |
| Sr-hse | 0.41 |
| Sr-mmp | 0.799 |
| Sr-p53 | 0.897 |
| Vol | 427.318 |
| Dense | 1.084 |
| Flex | 0.208 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 2 |
| Qed | 0.533 |
| Synth | 3.116 |
| Fsp3 | 0.273 |
| Mce-18 | 78.857 |
| Natural product-likeness | -1.001 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |