| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028704909 |
| Molecular Weight (Da) | 425 |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C23Cl1N2O2S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028704909 |
| Molar Refractivity | 116.608 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| LogP | 5.374 |
| Activity (Ki) in nM | 9.7724 |
| Polar Surface Area (PSA) | 78.34 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028704909 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.971 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.17 |
| Ilogp | 3.12 |
| Xlogp3 | 5.37 |
| Wlogp | 5.99 |
| Mlogp | 3.89 |
| Silicos-it log p | 4.84 |
| Consensus log p | 4.64 |
| Esol log s | -5.86 |
| Esol solubility (mg/ml) | 0.000593 |
| Esol solubility (mol/l) | 0.0000014 |
| Esol class | Moderately |
| Ali log s | -6.77 |
| Ali solubility (mg/ml) | 0.0000724 |
| Ali solubility (mol/l) | 0.00000017 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.9 |
| Silicos-it solubility (mg/ml) | 0.00000053 |
| Silicos-it solubility (mol/l) | 1.26E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.08 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.77 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -6.392 |
| Logd | 3.886 |
| Logp | 5.271 |
| F (20%) | 0.01 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 99.74% |
| Vdss | 0.59 |
| Fu | 0.68% |
| Cyp1a2-inh | 0.836 |
| Cyp1a2-sub | 0.734 |
| Cyp2c19-inh | 0.952 |
| Cyp2c19-sub | 0.142 |
| Cl | 5.396 |
| T12 | 0.016 |
| H-ht | 0.892 |
| Dili | 0.985 |
| Roa | 0.176 |
| Fdamdd | 0.94 |
| Skinsen | 0.031 |
| Ec | 0.003 |
| Ei | 0.047 |
| Respiratory | 0.033 |
| Bcf | 1.157 |
| Igc50 | 4.669 |
| Lc50 | 4.792 |
| Lc50dm | 4.657 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.017 |
| Nr-ahr | 0.004 |
| Nr-aromatase | 0.178 |
| Nr-er | 0.621 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.01 |
| Sr-are | 0.356 |
| Sr-atad5 | 0.008 |
| Sr-hse | 0.01 |
| Sr-mmp | 0.685 |
| Sr-p53 | 0.013 |
| Vol | 424.988 |
| Dense | 0.998 |
| Flex | 0.333 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.586 |
| Synth | 2.902 |
| Fsp3 | 0.174 |
| Mce-18 | 38 |
| Natural product-likeness | -1.234 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |