| General Information | |
|---|---|
| ZINC ID | ZINC000028704968 |
| Molecular Weight (Da) | 494 |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(Cl)cc1Cl)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C23Cl3N2O2S1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 126.218 |
| HBA | 3 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| LogP | 6.703 |
| Activity (Ki) in nM | 301.995 |
| Polar Surface Area (PSA) | 78.34 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.872 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.17 |
| Ilogp | 3.46 |
| Xlogp3 | 6.63 |
| Wlogp | 7.29 |
| Mlogp | 4.84 |
| Silicos-it log p | 6.14 |
| Consensus log p | 5.67 |
| Esol log s | -7.05 |
| Esol solubility (mg/ml) | 0.0000444 |
| Esol solubility (mol/l) | 8.99E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.08 |
| Ali solubility (mg/ml) | 0.00000414 |
| Ali solubility (mol/l) | 8.39E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.06 |
| Silicos-it solubility (mg/ml) | 0.00000004 |
| Silicos-it solubility (mol/l) | 8.71E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.61 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.86 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.148 |
| Logd | 3.661 |
| Logp | 6.258 |
| F (20%) | 0.002 |
| F (30%) | 0.005 |
| Mdck | 1.14E-05 |
| Ppb | 1.0097 |
| Vdss | 0.594 |
| Fu | 0.0075 |
| Cyp1a2-inh | 0.853 |
| Cyp1a2-sub | 0.759 |
| Cyp2c19-inh | 0.928 |
| Cyp2c19-sub | 0.085 |
| Cl | 5.16 |
| T12 | 0.012 |
| H-ht | 0.606 |
| Dili | 0.981 |
| Roa | 0.245 |
| Fdamdd | 0.967 |
| Skinsen | 0.023 |
| Ec | 0.003 |
| Ei | 0.022 |
| Respiratory | 0.023 |
| Bcf | 2.523 |
| Igc50 | 5.17 |
| Lc50 | 5.921 |
| Lc50dm | 5.814 |
| Nr-ar | 0.007 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.006 |
| Nr-aromatase | 0.855 |
| Nr-er | 0.498 |
| Nr-er-lbd | 0.012 |
| Nr-ppar-gamma | 0.019 |
| Sr-are | 0.646 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.012 |
| Sr-mmp | 0.855 |
| Sr-p53 | 0.213 |
| Vol | 455.41 |
| Dense | 1.08 |
| Flex | 0.333 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.425 |
| Synth | 3.089 |
| Fsp3 | 0.174 |
| Mce-18 | 42 |
| Natural product-likeness | -1.32 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |