| General Information | |
|---|---|
| ZINC ID | ZINC000028705091 |
| Molecular Weight (Da) | 389 |
| SMILES | C[C@H](NC(=O)c1ccccc1)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C24Cl1N2O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.031 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 5.671 |
| Activity (Ki) in nM | 1905.461 |
| Polar Surface Area (PSA) | 52.89 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 1.00876247 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.17 |
| Ilogp | 3.51 |
| Xlogp3 | 5.68 |
| Wlogp | 5.36 |
| Mlogp | 4.62 |
| Silicos-it log p | 5.94 |
| Consensus log p | 5.02 |
| Esol log s | -5.84 |
| Esol solubility (mg/ml) | 0.000558 |
| Esol solubility (mol/l) | 0.00000143 |
| Esol class | Moderately |
| Ali log s | -6.56 |
| Ali solubility (mg/ml) | 0.000108 |
| Ali solubility (mol/l) | 0.00000027 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.95 |
| Silicos-it solubility (mg/ml) | 0.00000043 |
| Silicos-it solubility (mol/l) | 1.11E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.64 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.08 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.896 |
| Logd | 4.021 |
| Logp | 5.34 |
| F (20%) | 0.041 |
| F (30%) | 0.003 |
| Mdck | 1.41E-05 |
| Ppb | 1.0008 |
| Vdss | 0.923 |
| Fu | 0.0057 |
| Cyp1a2-inh | 0.834 |
| Cyp1a2-sub | 0.586 |
| Cyp2c19-inh | 0.932 |
| Cyp2c19-sub | 0.073 |
| Cl | 6.918 |
| T12 | 0.076 |
| H-ht | 0.726 |
| Dili | 0.882 |
| Roa | 0.17 |
| Fdamdd | 0.809 |
| Skinsen | 0.053 |
| Ec | 0.003 |
| Ei | 0.076 |
| Respiratory | 0.035 |
| Bcf | 1.325 |
| Igc50 | 4.513 |
| Lc50 | 5.024 |
| Lc50dm | 5.976 |
| Nr-ar | 0.008 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.003 |
| Nr-aromatase | 0.037 |
| Nr-er | 0.672 |
| Nr-er-lbd | 0.008 |
| Nr-ppar-gamma | 0.714 |
| Sr-are | 0.185 |
| Sr-atad5 | 0.014 |
| Sr-hse | 0.01 |
| Sr-mmp | 0.521 |
| Sr-p53 | 0.118 |
| Vol | 412.348 |
| Dense | 0.941 |
| Flex | 0.35 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.618 |
| Synth | 2.754 |
| Fsp3 | 0.167 |
| Mce-18 | 34 |
| Natural product-likeness | -0.999 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |