| General Information | |
|---|---|
| ZINC ID | ZINC000028705121 |
| Molecular Weight (Da) | 458 |
| SMILES | C[C@H](NC(=O)c1c(Cl)cccc1Cl)[C@@H](Cc1ccc(Cl)cc1)c1cccc(C#N)c1 |
| Molecular Formula | C24Cl3N2O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 122.641 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| LogP | 7 |
| Activity (Ki) in nM | 954.993 |
| Polar Surface Area (PSA) | 52.89 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.148 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.17 |
| Ilogp | 3.51 |
| Xlogp3 | 6.94 |
| Wlogp | 6.66 |
| Mlogp | 5.56 |
| Silicos-it log p | 7.23 |
| Consensus log p | 5.98 |
| Esol log s | -7.03 |
| Esol solubility (mg/ml) | 0.0000425 |
| Esol solubility (mol/l) | 9.28E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.86 |
| Ali solubility (mg/ml) | 0.00000627 |
| Ali solubility (mol/l) | 1.37E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -10.12 |
| Silicos-it solubility (mg/ml) | 3.46E-08 |
| Silicos-it solubility (mol/l) | 7.55E-11 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.17 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.27 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.942 |
| Logd | 3.52 |
| Logp | 5.893 |
| F (20%) | 0.006 |
| F (30%) | 0.02 |
| Mdck | 9.53E-06 |
| Ppb | 1.0054 |
| Vdss | 1.543 |
| Fu | 0.0069 |
| Cyp1a2-inh | 0.801 |
| Cyp1a2-sub | 0.742 |
| Cyp2c19-inh | 0.915 |
| Cyp2c19-sub | 0.069 |
| Cl | 6.152 |
| T12 | 0.014 |
| H-ht | 0.375 |
| Dili | 0.827 |
| Roa | 0.24 |
| Fdamdd | 0.882 |
| Skinsen | 0.036 |
| Ec | 0.003 |
| Ei | 0.062 |
| Respiratory | 0.043 |
| Bcf | 2.706 |
| Igc50 | 4.949 |
| Lc50 | 5.913 |
| Lc50dm | 6.528 |
| Nr-ar | 0.058 |
| Nr-ar-lbd | 0.02 |
| Nr-ahr | 0.007 |
| Nr-aromatase | 0.338 |
| Nr-er | 0.539 |
| Nr-er-lbd | 0.01 |
| Nr-ppar-gamma | 0.89 |
| Sr-are | 0.19 |
| Sr-atad5 | 0.009 |
| Sr-hse | 0.015 |
| Sr-mmp | 0.64 |
| Sr-p53 | 0.201 |
| Vol | 442.77 |
| Dense | 1.03 |
| Flex | 0.35 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.45 |
| Synth | 2.988 |
| Fsp3 | 0.167 |
| Mce-18 | 38 |
| Natural product-likeness | -1.041 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |