| General Information | |
|---|---|
| ZINC ID | ZINC000028822070 |
| Molecular Weight (Da) | 351 |
| SMILES | CCCCCCC1(c2ccc(-c3cc(C)cc(C)c3)c(O)c2)CCCC1 |
| Molecular Formula | C25O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 112.041 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| LogP | 8.276 |
| Activity (Ki) in nM | 5.495 |
| Polar Surface Area (PSA) | 20.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.022 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.52 |
| Ilogp | 4.75 |
| Xlogp3 | 9.17 |
| Wlogp | 7.46 |
| Mlogp | 5.74 |
| Silicos-it log p | 7.91 |
| Consensus log p | 7.01 |
| Esol log s | -7.67 |
| Esol solubility (mg/ml) | 0.00000749 |
| Esol solubility (mol/l) | 2.14E-08 |
| Esol class | Poorly sol |
| Ali log s | -9.49 |
| Ali solubility (mg/ml) | 0.00000011 |
| Ali solubility (mol/l) | 3.22E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.86 |
| Silicos-it solubility (mg/ml) | 0.00000048 |
| Silicos-it solubility (mol/l) | 1.38E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -1.93 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.11 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.675 |
| Logd | 5.382 |
| Logp | 8.435 |
| F (20%) | 0.965 |
| F (30%) | 0.999 |
| Mdck | 6.42E-06 |
| Ppb | 0.9966 |
| Vdss | 1.411 |
| Fu | 0.0088 |
| Cyp1a2-inh | 0.307 |
| Cyp1a2-sub | 0.612 |
| Cyp2c19-inh | 0.581 |
| Cyp2c19-sub | 0.122 |
| Cl | 4.565 |
| T12 | 0.055 |
| H-ht | 0.155 |
| Dili | 0.033 |
| Roa | 0.141 |
| Fdamdd | 0.767 |
| Skinsen | 0.563 |
| Ec | 0.006 |
| Ei | 0.923 |
| Respiratory | 0.825 |
| Bcf | 2.567 |
| Igc50 | 5.514 |
| Lc50 | 6.113 |
| Lc50dm | 6.135 |
| Nr-ar | 0.038 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.309 |
| Nr-aromatase | 0.426 |
| Nr-er | 0.503 |
| Nr-er-lbd | 0.216 |
| Nr-ppar-gamma | 0.797 |
| Sr-are | 0.778 |
| Sr-atad5 | 0.014 |
| Sr-hse | 0.421 |
| Sr-mmp | 0.962 |
| Sr-p53 | 0.108 |
| Vol | 408.258 |
| Dense | 0.858 |
| Flex | 0.412 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.514 |
| Synth | 2.427 |
| Fsp3 | 0.52 |
| Mce-18 | 40.737 |
| Natural product-likeness | 0.556 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |