| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028822072 |
| Molecular Weight (Da) | 365 |
| SMILES | CCCCCCC1(c2ccc(-c3cc(C)cc(C)c3)c(O)c2)CCCCC1 |
| Molecular Formula | C26O1 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028822072 |
| Molecular Weight (Da) | 365 |
| SMILES | CCCCCCC1(c2ccc(-c3cc(C)cc(C)c3)c(O)c2)CCCCC1 |
| Molecular Formula | C26O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028822072 |
| Molar Refractivity | 116.642 |
| HBA | 1 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| LogP | 8.732 |
| Activity (Ki) in nM | 1.698 |
| Polar Surface Area (PSA) | 20.23 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028822072 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.046 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.54 |
| Ilogp | 4.91 |
| Xlogp3 | 9.71 |
| Wlogp | 7.85 |
| Mlogp | 5.94 |
| Silicos-it log p | 8.16 |
| Consensus log p | 7.31 |
| Esol log s | -8.08 |
| Esol solubility (mg/ml) | 0.000003 |
| Esol solubility (mol/l) | 8.23E-09 |
| Esol class | Poorly sol |
| Ali log s | -10.05 |
| Ali solubility (mg/ml) | 3.23E-08 |
| Ali solubility (mol/l) | 8.87E-11 |
| Ali class | Insoluble |
| Silicos-it logsw | -9.13 |
| Silicos-it solubility (mg/ml) | 0.00000027 |
| Silicos-it solubility (mol/l) | 7.41E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -1.63 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 2 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.23 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -6.762 |
| Logd | 5.491 |
| Logp | 8.832 |
| F (20%) | 0.969 |
| F (30%) | 0.999 |
| Mdck | 5.95E-06 |
| Ppb | 0.9981 |
| Vdss | 1.643 |
| Fu | 0.0081 |
| Cyp1a2-inh | 0.254 |
| Cyp1a2-sub | 0.502 |
| Cyp2c19-inh | 0.538 |
| Cyp2c19-sub | 0.112 |
| Cl | 4.51 |
| T12 | 0.045 |
| H-ht | 0.148 |
| Dili | 0.035 |
| Roa | 0.132 |
| Fdamdd | 0.765 |
| Skinsen | 0.656 |
| Ec | 0.006 |
| Ei | 0.925 |
| Respiratory | 0.802 |
| Bcf | 2.392 |
| Igc50 | 5.616 |
| Lc50 | 6.223 |
| Lc50dm | 6.197 |
| Nr-ar | 0.035 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.279 |
| Nr-aromatase | 0.403 |
| Nr-er | 0.493 |
| Nr-er-lbd | 0.201 |
| Nr-ppar-gamma | 0.801 |
| Sr-are | 0.781 |
| Sr-atad5 | 0.012 |
| Sr-hse | 0.415 |
| Sr-mmp | 0.962 |
| Sr-p53 | 0.09 |
| Vol | 425.554 |
| Dense | 0.856 |
| Flex | 0.389 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 1 |
| Qed | 0.496 |
| Synth | 2.432 |
| Fsp3 | 0.538 |
| Mce-18 | 41.4 |
| Natural product-likeness | 0.522 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |