| General Information | |
|---|---|
| ZINC ID | ZINC000028822122 |
| Molecular Weight (Da) | 326 |
| SMILES | CCCCCCC(C)(C)c1ccc(-c2cccc(OC)c2)c(O)c1 |
| Molecular Formula | C22O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 101.022 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| LogP | 6.746 |
| Activity (Ki) in nM | 91.2011 |
| Polar Surface Area (PSA) | 29.46 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.09165668 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.45 |
| Ilogp | 4.26 |
| Xlogp3 | 7.54 |
| Wlogp | 6.32 |
| Mlogp | 4.84 |
| Silicos-it log p | 6.29 |
| Consensus log p | 5.85 |
| Esol log s | -6.46 |
| Esol solubility (mg/ml) | 0.000114 |
| Esol solubility (mol/l) | 0.00000035 |
| Esol class | Poorly sol |
| Ali log s | -7.99 |
| Ali solubility (mg/ml) | 0.00000331 |
| Ali solubility (mol/l) | 1.01E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.68 |
| Silicos-it solubility (mg/ml) | 0.00000688 |
| Silicos-it solubility (mol/l) | 2.11E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -2.94 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.91 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.141 |
| Logd | 5.058 |
| Logp | 7.384 |
| F (20%) | 0.988 |
| F (30%) | 0.993 |
| Mdck | - |
| Ppb | 99.74% |
| Vdss | 2.434 |
| Fu | 1.28% |
| Cyp1a2-inh | 0.771 |
| Cyp1a2-sub | 0.805 |
| Cyp2c19-inh | 0.822 |
| Cyp2c19-sub | 0.094 |
| Cl | 5.311 |
| T12 | 0.064 |
| H-ht | 0.043 |
| Dili | 0.212 |
| Roa | 0.115 |
| Fdamdd | 0.324 |
| Skinsen | 0.929 |
| Ec | 0.159 |
| Ei | 0.967 |
| Respiratory | 0.26 |
| Bcf | 2.275 |
| Igc50 | 5.468 |
| Lc50 | 6.186 |
| Lc50dm | 6.535 |
| Nr-ar | 0.071 |
| Nr-ar-lbd | 0.01 |
| Nr-ahr | 0.066 |
| Nr-aromatase | 0.687 |
| Nr-er | 0.78 |
| Nr-er-lbd | 0.893 |
| Nr-ppar-gamma | 0.428 |
| Sr-are | 0.813 |
| Sr-atad5 | 0.178 |
| Sr-hse | 0.23 |
| Sr-mmp | 0.967 |
| Sr-p53 | 0.234 |
| Vol | 373.717 |
| Dense | 0.873 |
| Flex | 0.667 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.575 |
| Synth | 2.117 |
| Fsp3 | 0.455 |
| Mce-18 | 14 |
| Natural product-likeness | 0.164 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |