| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028822131 |
| Molecular Weight (Da) | 321 |
| SMILES | CCCCCCC(C)(C)c1ccc(-c2cccc(C#N)c2)c(O)c1 |
| Molecular Formula | C22N1O1 |
| Action | Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028822131 |
| Molecular Weight (Da) | 321 |
| SMILES | CCCCCCC(C)(C)c1ccc(-c2cccc(C#N)c2)c(O)c1 |
| Molecular Formula | C22N1O1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028822131 |
| Molar Refractivity | 100.297 |
| HBA | 2 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| LogP | 6.641 |
| Activity (Ki) in nM | 44.668 |
| Polar Surface Area (PSA) | 44.02 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028822131 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.033 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.41 |
| Ilogp | 3.91 |
| Xlogp3 | 7.29 |
| Wlogp | 6.18 |
| Mlogp | 4.49 |
| Silicos-it log p | 6.26 |
| Consensus log p | 5.63 |
| Esol log s | -6.33 |
| Esol solubility (mg/ml) | 0.000149 |
| Esol solubility (mol/l) | 0.00000046 |
| Esol class | Poorly sol |
| Ali log s | -8.04 |
| Ali solubility (mg/ml) | 0.00000293 |
| Ali solubility (mol/l) | 9.11E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.64 |
| Silicos-it solubility (mg/ml) | 0.0000074 |
| Silicos-it solubility (mol/l) | 0.00000002 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.08 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 2.92 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.817 |
| Logd | 4.866 |
| Logp | 7.163 |
| F (20%) | 0.9 |
| F (30%) | 0.972 |
| Mdck | 1.08E-05 |
| Ppb | 1.0006 |
| Vdss | 1.374 |
| Fu | 0.0034 |
| Cyp1a2-inh | 0.848 |
| Cyp1a2-sub | 0.539 |
| Cyp2c19-inh | 0.806 |
| Cyp2c19-sub | 0.065 |
| Cl | 5.331 |
| T12 | 0.068 |
| H-ht | 0.531 |
| Dili | 0.216 |
| Roa | 0.221 |
| Fdamdd | 0.735 |
| Skinsen | 0.802 |
| Ec | 0.089 |
| Ei | 0.964 |
| Respiratory | 0.619 |
| Bcf | 2.791 |
| Igc50 | 5.392 |
| Lc50 | 6.088 |
| Lc50dm | 6.289 |
| Nr-ar | 0.097 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.038 |
| Nr-aromatase | 0.797 |
| Nr-er | 0.71 |
| Nr-er-lbd | 0.869 |
| Nr-ppar-gamma | 0.932 |
| Sr-are | 0.761 |
| Sr-atad5 | 0.017 |
| Sr-hse | 0.3 |
| Sr-mmp | 0.974 |
| Sr-p53 | 0.455 |
| Vol | 370.651 |
| Dense | 0.867 |
| Flex | 0.538 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.619 |
| Synth | 2.283 |
| Fsp3 | 0.409 |
| Mce-18 | 14 |
| Natural product-likeness | -0.225 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |