| General Information | |
|---|---|
| ZINC ID | ZINC000028822597 |
| Molecular Weight (Da) | 393 |
| SMILES | CSC(=S)N1CC2(CCCCC2)CS/C1=Nc1ccccc1C(C)C |
| Molecular Formula | C20N2S3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.632 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 7.427 |
| Activity (Ki) in nM | 79.4328 |
| Polar Surface Area (PSA) | 98.29 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.105 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.6 |
| Ilogp | 3.69 |
| Xlogp3 | 6.96 |
| Wlogp | 6.06 |
| Mlogp | 4.63 |
| Silicos-it log p | 6.51 |
| Consensus log p | 5.57 |
| Esol log s | -6.57 |
| Esol solubility (mg/ml) | 0.000105 |
| Esol solubility (mol/l) | 0.00000026 |
| Esol class | Poorly sol |
| Ali log s | -8.84 |
| Ali solubility (mg/ml) | 0.00000057 |
| Ali solubility (mol/l) | 1.45E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.76 |
| Silicos-it solubility (mg/ml) | 0.000676 |
| Silicos-it solubility (mol/l) | 0.00000172 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.75 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.43 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.983 |
| Logd | 5.183 |
| Logp | 5.743 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 99.24% |
| Vdss | 1.527 |
| Fu | 1.95% |
| Cyp1a2-inh | 0.888 |
| Cyp1a2-sub | 0.669 |
| Cyp2c19-inh | 0.844 |
| Cyp2c19-sub | 0.862 |
| Cl | 3.787 |
| T12 | 0.021 |
| H-ht | 0.717 |
| Dili | 0.905 |
| Roa | 0.176 |
| Fdamdd | 0.749 |
| Skinsen | 0.123 |
| Ec | 0.004 |
| Ei | 0.197 |
| Respiratory | 0.941 |
| Bcf | 2.215 |
| Igc50 | 4.883 |
| Lc50 | 5.993 |
| Lc50dm | 5.843 |
| Nr-ar | 0.022 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.872 |
| Nr-aromatase | 0.988 |
| Nr-er | 0.42 |
| Nr-er-lbd | 0.204 |
| Nr-ppar-gamma | 0.729 |
| Sr-are | 0.938 |
| Sr-atad5 | 0.31 |
| Sr-hse | 0.985 |
| Sr-mmp | 0.964 |
| Sr-p53 | 0.403 |
| Vol | 393.145 |
| Dense | 0.997 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | - |
| Toxicophores | 4 |
| Qed | 0.537 |
| Synth | 3.595 |
| Fsp3 | 0.6 |
| Mce-18 | 63 |
| Natural product-likeness | -0.596 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |