| General Information | |
|---|---|
| ZINC ID | ZINC000028822598 |
| Molecular Weight (Da) | 393 |
| SMILES | CSC(=S)N1CC2(CCCCC2)CS/C1=Nc1cccc(C(C)C)c1 |
| Molecular Formula | C20N2S3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 117.632 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| LogP | 7.427 |
| Activity (Ki) in nM | 2.512 |
| Polar Surface Area (PSA) | 98.29 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.1134864 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.6 |
| Ilogp | 3.78 |
| Xlogp3 | 6.96 |
| Wlogp | 6.06 |
| Mlogp | 4.63 |
| Silicos-it log p | 6.51 |
| Consensus log p | 5.59 |
| Esol log s | -6.57 |
| Esol solubility (mg/ml) | 0.000105 |
| Esol solubility (mol/l) | 0.00000026 |
| Esol class | Poorly sol |
| Ali log s | -8.84 |
| Ali solubility (mg/ml) | 0.00000057 |
| Ali solubility (mol/l) | 1.45E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.76 |
| Silicos-it solubility (mg/ml) | 0.000676 |
| Silicos-it solubility (mol/l) | 0.00000172 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.75 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.45 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.97 |
| Logd | 5.054 |
| Logp | 5.821 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 1.83E-05 |
| Ppb | 0.9949 |
| Vdss | 1.47 |
| Fu | 0.0187 |
| Cyp1a2-inh | 0.927 |
| Cyp1a2-sub | 0.527 |
| Cyp2c19-inh | 0.799 |
| Cyp2c19-sub | 0.625 |
| Cl | 3.994 |
| T12 | 0.023 |
| H-ht | 0.568 |
| Dili | 0.892 |
| Roa | 0.066 |
| Fdamdd | 0.789 |
| Skinsen | 0.09 |
| Ec | 0.013 |
| Ei | 0.445 |
| Respiratory | 0.939 |
| Bcf | 2.471 |
| Igc50 | 5.033 |
| Lc50 | 6.09 |
| Lc50dm | 6.025 |
| Nr-ar | 0.019 |
| Nr-ar-lbd | 0.006 |
| Nr-ahr | 0.918 |
| Nr-aromatase | 0.986 |
| Nr-er | 0.475 |
| Nr-er-lbd | 0.135 |
| Nr-ppar-gamma | 0.737 |
| Sr-are | 0.942 |
| Sr-atad5 | 0.221 |
| Sr-hse | 0.986 |
| Sr-mmp | 0.972 |
| Sr-p53 | 0.433 |
| Vol | 393.145 |
| Dense | 0.997 |
| Flex | 0.2 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 4 |
| Qed | 0.537 |
| Synth | 3.583 |
| Fsp3 | 0.6 |
| Mce-18 | 63 |
| Natural product-likeness | -0.711 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |