| General Information | |
|---|---|
| ZINC ID | ZINC000028822627 |
| Molecular Weight (Da) | 435 |
| SMILES | CSC(=S)N1CC2(CCCCC2)CS/C1=Nc1ccccc1OC(F)(F)F |
| Molecular Formula | C18F3N2O1S3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 111.015 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| LogP | 8.352 |
| Activity (Ki) in nM | 12.023 |
| Polar Surface Area (PSA) | 107.52 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.99390769 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.56 |
| Ilogp | 3.7 |
| Xlogp3 | 7.01 |
| Wlogp | 7.1 |
| Mlogp | 3.9 |
| Silicos-it log p | 6.01 |
| Consensus log p | 5.54 |
| Esol log s | -6.79 |
| Esol solubility (mg/ml) | 0.0000713 |
| Esol solubility (mol/l) | 0.00000016 |
| Esol class | Poorly sol |
| Ali log s | -9.08 |
| Ali solubility (mg/ml) | 0.00000035 |
| Ali solubility (mol/l) | 8.25E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.53 |
| Silicos-it solubility (mg/ml) | 0.00128 |
| Silicos-it solubility (mol/l) | 0.00000295 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.97 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.35 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.505 |
| Logd | 4.761 |
| Logp | 5.797 |
| F (20%) | 0.002 |
| F (30%) | 0.001 |
| Mdck | 2.56E-05 |
| Ppb | 0.998 |
| Vdss | 4.26 |
| Fu | 0.012 |
| Cyp1a2-inh | 0.966 |
| Cyp1a2-sub | 0.654 |
| Cyp2c19-inh | 0.859 |
| Cyp2c19-sub | 0.532 |
| Cl | 6.916 |
| T12 | 0.028 |
| H-ht | 0.986 |
| Dili | 0.937 |
| Roa | 0.45 |
| Fdamdd | 0.838 |
| Skinsen | 0.114 |
| Ec | 0.003 |
| Ei | 0.023 |
| Respiratory | 0.947 |
| Bcf | 1.776 |
| Igc50 | 4.583 |
| Lc50 | 5.886 |
| Lc50dm | 6.078 |
| Nr-ar | 0.006 |
| Nr-ar-lbd | 0.106 |
| Nr-ahr | 0.963 |
| Nr-aromatase | 0.985 |
| Nr-er | 0.35 |
| Nr-er-lbd | 0.37 |
| Nr-ppar-gamma | 0.835 |
| Sr-are | 0.927 |
| Sr-atad5 | 0.592 |
| Sr-hse | 0.986 |
| Sr-mmp | 0.96 |
| Sr-p53 | 0.906 |
| Vol | 385.546 |
| Dense | 1.126 |
| Flex | 0.25 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 4 |
| Nonbiodegradable | 1 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 3 |
| Toxicophores | 4 |
| Qed | 0.515 |
| Synth | 3.678 |
| Fsp3 | 0.556 |
| Mce-18 | 71.429 |
| Natural product-likeness | -0.864 |
| Alarm nmr | 4 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 3 |
| Gsk | Rejected |
| Goldentriangle | Accepted |