| General Information | |
|---|---|
| ZINC ID | ZINC000028822629 |
| Molecular Weight (Da) | 379 |
| SMILES | CSC(=S)N1CC2(CCCCC2)CS/C1=Nc1cccc(C)c1C |
| Molecular Formula | C19N2S3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 113.524 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| LogP | 7.205 |
| Activity (Ki) in nM | 1 |
| Polar Surface Area (PSA) | 98.29 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 1.10136497 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.58 |
| Ilogp | 3.64 |
| Xlogp3 | 6.56 |
| Wlogp | 5.56 |
| Mlogp | 4.4 |
| Silicos-it log p | 6.43 |
| Consensus log p | 5.32 |
| Esol log s | -6.31 |
| Esol solubility (mg/ml) | 0.000187 |
| Esol solubility (mol/l) | 0.00000049 |
| Esol class | Poorly sol |
| Ali log s | -8.42 |
| Ali solubility (mg/ml) | 0.00000143 |
| Ali solubility (mol/l) | 3.78E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.73 |
| Silicos-it solubility (mg/ml) | 0.00071 |
| Silicos-it solubility (mol/l) | 0.00000187 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.95 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.38 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.87 |
| Logd | 4.742 |
| Logp | 5.697 |
| F (20%) | 0.001 |
| F (30%) | 0.001 |
| Mdck | 2.39E-05 |
| Ppb | 0.9892 |
| Vdss | 1.663 |
| Fu | 0.0144 |
| Cyp1a2-inh | 0.939 |
| Cyp1a2-sub | 0.742 |
| Cyp2c19-inh | 0.863 |
| Cyp2c19-sub | 0.814 |
| Cl | 5.331 |
| T12 | 0.029 |
| H-ht | 0.793 |
| Dili | 0.861 |
| Roa | 0.08 |
| Fdamdd | 0.618 |
| Skinsen | 0.107 |
| Ec | 0.015 |
| Ei | 0.559 |
| Respiratory | 0.951 |
| Bcf | 2.527 |
| Igc50 | 4.899 |
| Lc50 | 5.833 |
| Lc50dm | 5.836 |
| Nr-ar | 0.025 |
| Nr-ar-lbd | 0.014 |
| Nr-ahr | 0.944 |
| Nr-aromatase | 0.978 |
| Nr-er | 0.401 |
| Nr-er-lbd | 0.161 |
| Nr-ppar-gamma | 0.862 |
| Sr-are | 0.935 |
| Sr-atad5 | 0.36 |
| Sr-hse | 0.984 |
| Sr-mmp | 0.958 |
| Sr-p53 | 0.6 |
| Vol | 375.849 |
| Dense | 1.006 |
| Flex | 0.15 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 4 |
| Qed | 0.562 |
| Synth | 3.619 |
| Fsp3 | 0.579 |
| Mce-18 | 63.6 |
| Natural product-likeness | -0.814 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |