| General Information | |
|---|---|
| ZINC ID | ZINC000028822642 |
| Molecular Weight (Da) | 420 |
| SMILES | CSC(=S)N1CC2(CCCCC2)CS/C1=Nc1cccc2c1CCCN2C |
| Molecular Formula | C21N3S3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.78 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| LogP | 6.926 |
| Activity (Ki) in nM | 1.096 |
| Polar Surface Area (PSA) | 101.53 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | + |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.878 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.62 |
| Ilogp | 3.75 |
| Xlogp3 | 6.35 |
| Wlogp | 4.94 |
| Mlogp | 4.24 |
| Silicos-it log p | 5.76 |
| Consensus log p | 5.01 |
| Esol log s | -6.41 |
| Esol solubility (mg/ml) | 0.000164 |
| Esol solubility (mol/l) | 0.00000039 |
| Esol class | Poorly sol |
| Ali log s | -8.27 |
| Ali solubility (mg/ml) | 0.00000224 |
| Ali solubility (mol/l) | 5.34E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.47 |
| Silicos-it solubility (mg/ml) | 0.00142 |
| Silicos-it solubility (mol/l) | 0.00000338 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.35 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.49 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.257 |
| Logd | 4.435 |
| Logp | 5.874 |
| F (20%) | 0.002 |
| F (30%) | 0.009 |
| Mdck | 2.57E-05 |
| Ppb | 0.9803 |
| Vdss | 1.384 |
| Fu | 0.0166 |
| Cyp1a2-inh | 0.942 |
| Cyp1a2-sub | 0.727 |
| Cyp2c19-inh | 0.875 |
| Cyp2c19-sub | 0.833 |
| Cl | 5.229 |
| T12 | 0.019 |
| H-ht | 0.906 |
| Dili | 0.891 |
| Roa | 0.455 |
| Fdamdd | 0.904 |
| Skinsen | 0.096 |
| Ec | 0.004 |
| Ei | 0.072 |
| Respiratory | 0.968 |
| Bcf | 1.812 |
| Igc50 | 4.853 |
| Lc50 | 5.879 |
| Lc50dm | 5.885 |
| Nr-ar | 0.026 |
| Nr-ar-lbd | 0.102 |
| Nr-ahr | 0.968 |
| Nr-aromatase | 0.96 |
| Nr-er | 0.55 |
| Nr-er-lbd | 0.351 |
| Nr-ppar-gamma | 0.944 |
| Sr-are | 0.953 |
| Sr-atad5 | 0.55 |
| Sr-hse | 0.989 |
| Sr-mmp | 0.967 |
| Sr-p53 | 0.918 |
| Vol | 412.881 |
| Dense | 1.015 |
| Flex | 0.12 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 2 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 2 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 4 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 4 |
| Qed | 0.542 |
| Synth | 3.802 |
| Fsp3 | 0.619 |
| Mce-18 | 80.235 |
| Natural product-likeness | -0.72 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |