| General Information | |
|---|---|
| ZINC ID | ZINC000028826566 |
| Molecular Weight (Da) | 337 |
| SMILES | C=C(C)[C@H]1CCC(C)=C[C@H]1c1c(O)cc(C2(C#N)CCCC2)cc1O |
| Molecular Formula | C22N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.936 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| LogP | 5.586 |
| Activity (Ki) in nM | 104.713 |
| Polar Surface Area (PSA) | 64.25 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | - |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.94698917 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.5 |
| Ilogp | 3.45 |
| Xlogp3 | 5.18 |
| Wlogp | 5.45 |
| Mlogp | 3.56 |
| Silicos-it log p | 4.85 |
| Consensus log p | 4.5 |
| Esol log s | -5.18 |
| Esol solubility (mg/ml) | 0.00225 |
| Esol solubility (mol/l) | 0.00000668 |
| Esol class | Moderately |
| Ali log s | -6.28 |
| Ali solubility (mg/ml) | 0.000179 |
| Ali solubility (mol/l) | 0.00000053 |
| Ali class | Poorly sol |
| Silicos-it logsw | -4.86 |
| Silicos-it solubility (mg/ml) | 0.00469 |
| Silicos-it solubility (mol/l) | 0.0000139 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.68 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 1 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 3.95 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.042 |
| Logd | 3.776 |
| Logp | 5.439 |
| F (20%) | 0.973 |
| F (30%) | 0.097 |
| Mdck | 1.65E-05 |
| Ppb | 0.9699 |
| Vdss | 6.056 |
| Fu | 0.0182 |
| Cyp1a2-inh | 0.78 |
| Cyp1a2-sub | 0.926 |
| Cyp2c19-inh | 0.897 |
| Cyp2c19-sub | 0.285 |
| Cl | 4.489 |
| T12 | 0.092 |
| H-ht | 0.299 |
| Dili | 0.157 |
| Roa | 0.875 |
| Fdamdd | 0.943 |
| Skinsen | 0.151 |
| Ec | 0.011 |
| Ei | 0.695 |
| Respiratory | 0.978 |
| Bcf | 1.548 |
| Igc50 | 4.746 |
| Lc50 | 6.396 |
| Lc50dm | 6.794 |
| Nr-ar | 0.469 |
| Nr-ar-lbd | 0.931 |
| Nr-ahr | 0.642 |
| Nr-aromatase | 0.83 |
| Nr-er | 0.941 |
| Nr-er-lbd | 0.905 |
| Nr-ppar-gamma | 0.61 |
| Sr-are | 0.854 |
| Sr-atad5 | 0.027 |
| Sr-hse | 0.87 |
| Sr-mmp | 0.972 |
| Sr-p53 | 0.958 |
| Vol | 373.521 |
| Dense | 0.903 |
| Flex | 0.158 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 3 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.721 |
| Synth | 3.943 |
| Fsp3 | 0.5 |
| Mce-18 | 70.909 |
| Natural product-likeness | 1.591 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |