| General Information | |
|---|---|
| ZINC ID | ZINC000028864828 |
| Molecular Weight (Da) | 369 |
| SMILES | CCCCCn1cc(C(=O)c2ccc3ccccc3c2)c(=O)c2ccccc21 |
| Molecular Formula | C25N1O2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 110.804 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| LogP | 6.214 |
| Activity (Ki) in nM | 1288.25 |
| Polar Surface Area (PSA) | 39.07 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.1392498 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 20 |
| Fraction csp3 | 0.2 |
| Ilogp | 3.28 |
| Xlogp3 | 6.29 |
| Wlogp | 5.58 |
| Mlogp | 3.41 |
| Silicos-it log p | 6.07 |
| Consensus log p | 4.92 |
| Esol log s | -6.23 |
| Esol solubility (mg/ml) | 2.20E-04 |
| Esol solubility (mol/l) | 5.94E-07 |
| Esol class | Poorly sol |
| Ali log s | -6.9 |
| Ali solubility (mg/ml) | 4.66E-05 |
| Ali solubility (mol/l) | 1.26E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.88 |
| Silicos-it solubility (mg/ml) | 4.92E-07 |
| Silicos-it solubility (mol/l) | 1.33E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.09 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 2.74 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.714 |
| Logd | 4.252 |
| Logp | 5.544 |
| F (20%) | 0.233 |
| F (30%) | 0.977 |
| Mdck | 1.14E-05 |
| Ppb | 0.9942 |
| Vdss | 0.801 |
| Fu | 0.0062 |
| Cyp1a2-inh | 0.58 |
| Cyp1a2-sub | 0.199 |
| Cyp2c19-inh | 0.594 |
| Cyp2c19-sub | 0.062 |
| Cl | 1.972 |
| T12 | 0.041 |
| H-ht | 0.084 |
| Dili | 0.937 |
| Roa | 0.1 |
| Fdamdd | 0.671 |
| Skinsen | 0.673 |
| Ec | 0.003 |
| Ei | 0.842 |
| Respiratory | 0.197 |
| Bcf | 2.233 |
| Igc50 | 5.376 |
| Lc50 | 5.947 |
| Lc50dm | 6.223 |
| Nr-ar | 0.061 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.743 |
| Nr-aromatase | 0.922 |
| Nr-er | 0.869 |
| Nr-er-lbd | 0.849 |
| Nr-ppar-gamma | 0.007 |
| Sr-are | 0.833 |
| Sr-atad5 | 0.73 |
| Sr-hse | 0.045 |
| Sr-mmp | 0.807 |
| Sr-p53 | 0.61 |
| Vol | 406.306 |
| Dense | 0.909 |
| Flex | 24 |
| Nstereo | 0.25 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 4 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 0 |
| Qed | 1 |
| Synth | 0.329 |
| Fsp3 | 2.046 |
| Mce-18 | 0.2 |
| Natural product-likeness | 21 |
| Alarm nmr | -0.734 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |