| General Information | |
|---|---|
| ZINC ID | ZINC000028875833 |
| Molecular Weight (Da) | 471 |
| SMILES | C[C@H](CO)NC(=O)CCC/C=CC/C=CCCOc1cccc(C(C)(C)CCCCN=[N+]=[N-])c1 |
| Molecular Formula | C27N4O3 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 131.762 |
| HBA | 3 |
| HBD | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| LogP | 4.145 |
| Activity (Ki) in nM | 2.512 |
| Polar Surface Area (PSA) | 70.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | - |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | - |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.705 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.59 |
| Ilogp | 4.82 |
| Xlogp3 | 6.58 |
| Wlogp | 6.38 |
| Mlogp | 4.82 |
| Silicos-it log p | 5.3 |
| Consensus log p | 5.49 |
| Esol log s | -7.21 |
| Esol solubility (mg/ml) | 0.0000332 |
| Esol solubility (mol/l) | 6.17E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.97 |
| Ali solubility (mg/ml) | 0.00000571 |
| Ali solubility (mol/l) | 1.06E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.51 |
| Silicos-it solubility (mg/ml) | 0.00000016 |
| Silicos-it solubility (mol/l) | 3.08E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.91 |
| Lipinski number of violations | 2 |
| Ghose number of violations | 3 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.17 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 3 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.287 |
| Logd | 3.801 |
| Logp | 4.171 |
| F (20%) | 0.982 |
| F (30%) | 1 |
| Mdck | 1.58E-05 |
| Ppb | 0.9833 |
| Vdss | 2.373 |
| Fu | 0.0132 |
| Cyp1a2-inh | 0.018 |
| Cyp1a2-sub | 0.276 |
| Cyp2c19-inh | 0.085 |
| Cyp2c19-sub | 0.921 |
| Cl | 3.767 |
| T12 | 0.929 |
| H-ht | 0.348 |
| Dili | 0.231 |
| Roa | 0.006 |
| Fdamdd | 0.279 |
| Skinsen | 0.923 |
| Ec | 0.003 |
| Ei | 0.012 |
| Respiratory | 0.932 |
| Bcf | 0.939 |
| Igc50 | 4.794 |
| Lc50 | 3.78 |
| Lc50dm | 4.467 |
| Nr-ar | 0.01 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.049 |
| Nr-aromatase | 0.005 |
| Nr-er | 0.126 |
| Nr-er-lbd | 0.002 |
| Nr-ppar-gamma | 0.044 |
| Sr-are | 0.893 |
| Sr-atad5 | 0.006 |
| Sr-hse | 0.084 |
| Sr-mmp | 0.422 |
| Sr-p53 | 0.001 |
| Vol | 516.258 |
| Dense | 0.911 |
| Flex | 1.727 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 3 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.085 |
| Synth | 3.505 |
| Fsp3 | 0.593 |
| Mce-18 | 20 |
| Natural product-likeness | 0.31 |
| Alarm nmr | 2 |
| Bms | 1 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |