| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028898277 |
| Molecular Weight (Da) | 520 |
| SMILES | C[C@H](NS(C)(=O)=O)c1ccc(S(=O)(=O)c2ccc(Cl)cc2S(=O)(=O)C2CCCCC2)cc1 |
| Molecular Formula | C21Cl1N1O6S3 |
| Action | Inverse Agonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028898277 |
| Molecular Weight (Da) | 520 |
| SMILES | C[C@H](NS(C)(=O)=O)c1ccc(S(=O)(=O)c2ccc(Cl)cc2S(=O)(=O)C2CCCCC2)cc1 |
| Molecular Formula | C21Cl1N1O6S3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028898277 |
| Molar Refractivity | 125.471 |
| HBA | 6 |
| HBD | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| LogP | 4.277 |
| Activity (Ki) in nM | 8.9125 |
| Polar Surface Area (PSA) | 139.59 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028898277 |
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.973 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 12 |
| Fraction csp3 | 0.43 |
| Ilogp | 2.82 |
| Xlogp3 | 3.7 |
| Wlogp | 6.81 |
| Mlogp | 2.79 |
| Silicos-it log p | 2.64 |
| Consensus log p | 3.75 |
| Esol log s | -5.21 |
| Esol solubility (mg/ml) | 0.0032 |
| Esol solubility (mol/l) | 0.00000615 |
| Esol class | Moderately |
| Ali log s | -6.32 |
| Ali solubility (mg/ml) | 0.000248 |
| Ali solubility (mol/l) | 0.00000047 |
| Ali class | Poorly sol |
| Silicos-it logsw | -7.42 |
| Silicos-it solubility (mg/ml) | 0.00002 |
| Silicos-it solubility (mol/l) | 3.85E-08 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.85 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 2 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.23 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.122 |
| Logd | 2.398 |
| Logp | 3.927 |
| F (20%) | 0.001 |
| F (30%) | 0.023 |
| Mdck | - |
| Ppb | 96.91% |
| Vdss | 0.467 |
| Fu | 1.89% |
| Cyp1a2-inh | 0.139 |
| Cyp1a2-sub | 0.632 |
| Cyp2c19-inh | 0.58 |
| Cyp2c19-sub | 0.848 |
| Cl | 1.337 |
| T12 | 0.018 |
| H-ht | 0.982 |
| Dili | 0.998 |
| Roa | 0.126 |
| Fdamdd | 0.992 |
| Skinsen | 0.022 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.005 |
| Bcf | 0.18 |
| Igc50 | 3.88 |
| Lc50 | 3.857 |
| Lc50dm | 4.513 |
| Nr-ar | 0.001 |
| Nr-ar-lbd | 0.011 |
| Nr-ahr | 0.021 |
| Nr-aromatase | 0.029 |
| Nr-er | 0.071 |
| Nr-er-lbd | 0.005 |
| Nr-ppar-gamma | 0.017 |
| Sr-are | 0.402 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.002 |
| Sr-mmp | 0.775 |
| Sr-p53 | 0.003 |
| Vol | 464.76 |
| Dense | 1.117 |
| Flex | 0.292 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 1 |
| Qed | 0.593 |
| Synth | 3.026 |
| Fsp3 | 0.429 |
| Mce-18 | 85 |
| Natural product-likeness | -1.362 |
| Alarm nmr | 2 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Rejected |