| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028900224 |
| Molecular Weight (Da) | 408 |
| SMILES | Cc1ccc(-c2ncc(C(=O)N(C)Cc3ccccc3)nc2-c2ccc(C)cc2)cc1 |
| Molecular Formula | C27N3O1 |
| Action | Antagonist |
| General Information | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028900224 |
| Molecular Weight (Da) | 408 |
| SMILES | Cc1ccc(-c2ncc(C(=O)N(C)Cc3ccccc3)nc2-c2ccc(C)cc2)cc1 |
| Molecular Formula | C27N3O1 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028900224 |
| Molar Refractivity | 123.97 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 5.821 |
| Activity (Ki) in nM | 109.648 |
| Polar Surface Area (PSA) | 46.09 |
| Pharmacokinetic Properties | |
|---|---|
| ZINC ID/ Molecule Name | ZINC000028900224 |
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Oatp2b1 inhibitor | - |
| Oatp1b1 inhibitor | + |
| Oatp1b3 inhibitor | + |
| Mate1 inhibitor | - |
| Oct2 inhibitor | - |
| Bsep inhibitor | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.0634346 |
| Pharmacokinetic Properties | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0.15 |
| Ilogp | 4.2 |
| Xlogp3 | 5.12 |
| Wlogp | 5.55 |
| Mlogp | 3.37 |
| Silicos-it log p | 6.01 |
| Consensus log p | 4.85 |
| Esol log s | -5.77 |
| Esol solubility (mg/ml) | 0.000694 |
| Esol solubility (mol/l) | 0.0000017 |
| Esol class | Moderately |
| Ali log s | -5.83 |
| Ali solubility (mg/ml) | 0.0006 |
| Ali solubility (mol/l) | 0.00000147 |
| Ali class | Moderately |
| Silicos-it logsw | -9.97 |
| Silicos-it solubility (mg/ml) | 4.37E-08 |
| Silicos-it solubility (mol/l) | 1.07E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.15 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.39 |
| Pharmacokinetic Properties | |
|---|---|
| Logs | -5.942 |
| Logd | 4.472 |
| Logp | 5.291 |
| F (20%) | 0.002 |
| F (30%) | 0.001 |
| Mdck | - |
| Ppb | 98.92% |
| Vdss | 1.441 |
| Fu | 0.95% |
| Cyp1a2-inh | 0.336 |
| Cyp1a2-sub | 0.913 |
| Cyp2c19-inh | 0.846 |
| Cyp2c19-sub | 0.134 |
| Cl | 7.671 |
| T12 | 0.078 |
| H-ht | 0.491 |
| Dili | 0.984 |
| Roa | 0.335 |
| Fdamdd | 0.053 |
| Skinsen | 0.018 |
| Ec | 0.003 |
| Ei | 0.015 |
| Respiratory | 0.115 |
| Bcf | 2.343 |
| Igc50 | 4.765 |
| Lc50 | 5.661 |
| Lc50dm | 5.501 |
| Nr-ar | 0.018 |
| Nr-ar-lbd | 0.157 |
| Nr-ahr | 0.107 |
| Nr-aromatase | 0.84 |
| Nr-er | 0.599 |
| Nr-er-lbd | 0.038 |
| Nr-ppar-gamma | 0.537 |
| Sr-are | 0.689 |
| Sr-atad5 | 0.584 |
| Sr-hse | 0.113 |
| Sr-mmp | 0.496 |
| Sr-p53 | 0.533 |
| Vol | 448.829 |
| Dense | 0.907 |
| Flex | 0.24 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.426 |
| Synth | 2.096 |
| Fsp3 | 0.148 |
| Mce-18 | 22 |
| Natural product-likeness | -1.125 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |