| General Information | |
|---|---|
| ZINC ID | ZINC000028900413 |
| Molecular Weight (Da) | 416 |
| SMILES | Cc1ccc(-c2ncc(C(=O)N[C@@H]3CCCC[C@H]3CO)nc2-c2ccc(C)cc2)cc1 |
| Molecular Formula | C26N3O2 |
| Action | Antagonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 121.776 |
| HBA | 4 |
| HBD | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 4.989 |
| Activity (Ki) in nM | 50.1187 |
| Polar Surface Area (PSA) | 75.11 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.769 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.35 |
| Ilogp | 4.17 |
| Xlogp3 | 5.02 |
| Wlogp | 4.71 |
| Mlogp | 2.55 |
| Silicos-it log p | 5.26 |
| Consensus log p | 4.34 |
| Esol log s | -5.61 |
| Esol solubility (mg/ml) | 0.00101 |
| Esol solubility (mol/l) | 0.00000244 |
| Esol class | Moderately |
| Ali log s | -6.34 |
| Ali solubility (mg/ml) | 0.000191 |
| Ali solubility (mol/l) | 0.00000045 |
| Ali class | Poorly sol |
| Silicos-it logsw | -8.4 |
| Silicos-it solubility (mg/ml) | 0.00000164 |
| Silicos-it solubility (mol/l) | 3.94E-09 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -5.27 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 4.18 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.461 |
| Logd | 4.589 |
| Logp | 5.686 |
| F (20%) | 0.031 |
| F (30%) | 0.401 |
| Mdck | - |
| Ppb | 97.34% |
| Vdss | 1.586 |
| Fu | 1.50% |
| Cyp1a2-inh | 0.321 |
| Cyp1a2-sub | 0.154 |
| Cyp2c19-inh | 0.684 |
| Cyp2c19-sub | 0.07 |
| Cl | 5.081 |
| T12 | 0.075 |
| H-ht | 0.902 |
| Dili | 0.982 |
| Roa | 0.595 |
| Fdamdd | 0.296 |
| Skinsen | 0.049 |
| Ec | 0.003 |
| Ei | 0.02 |
| Respiratory | 0.319 |
| Bcf | 1.522 |
| Igc50 | 4.858 |
| Lc50 | 5.584 |
| Lc50dm | 5.424 |
| Nr-ar | 0.019 |
| Nr-ar-lbd | 0.034 |
| Nr-ahr | 0.095 |
| Nr-aromatase | 0.836 |
| Nr-er | 0.319 |
| Nr-er-lbd | 0.007 |
| Nr-ppar-gamma | 0.9 |
| Sr-are | 0.539 |
| Sr-atad5 | 0.648 |
| Sr-hse | 0.734 |
| Sr-mmp | 0.655 |
| Sr-p53 | 0.941 |
| Vol | 448.232 |
| Dense | 0.926 |
| Flex | 0.24 |
| Nstereo | 2 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 0 |
| Qed | 0.633 |
| Synth | 3.028 |
| Fsp3 | 0.346 |
| Mce-18 | 73.543 |
| Natural product-likeness | -0.412 |
| Alarm nmr | 0 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |