| General Information | |
|---|---|
| ZINC ID | ZINC000028902895 |
| Molecular Weight (Da) | 470 |
| SMILES | N#Cc1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)nc1Oc1cccc(F)c1 |
| Molecular Formula | C24Cl3F1N2O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.724 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 8.324 |
| Activity (Ki) in nM | 2290.868 |
| Polar Surface Area (PSA) | 45.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.994 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0 |
| Ilogp | 4.09 |
| Xlogp3 | 7.71 |
| Wlogp | 8.6 |
| Mlogp | 5.66 |
| Silicos-it log p | 7.94 |
| Consensus log p | 6.8 |
| Esol log s | -7.92 |
| Esol solubility (mg/ml) | 0.00000567 |
| Esol solubility (mol/l) | 1.21E-08 |
| Esol class | Poorly sol |
| Ali log s | -8.52 |
| Ali solubility (mg/ml) | 0.00000143 |
| Ali solubility (mol/l) | 3.05E-09 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.38 |
| Silicos-it solubility (mg/ml) | 1.94E-09 |
| Silicos-it solubility (mol/l) | 4.13E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.69 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.38 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.838 |
| Logd | 4.239 |
| Logp | 7.024 |
| F (20%) | 0.003 |
| F (30%) | 0.015 |
| Mdck | 1.02E-05 |
| Ppb | 1.0489 |
| Vdss | 0.376 |
| Fu | 0.0053 |
| Cyp1a2-inh | 0.906 |
| Cyp1a2-sub | 0.192 |
| Cyp2c19-inh | 0.776 |
| Cyp2c19-sub | 0.054 |
| Cl | 6.791 |
| T12 | 0.013 |
| H-ht | 0.453 |
| Dili | 0.945 |
| Roa | 0.118 |
| Fdamdd | 0.893 |
| Skinsen | 0.033 |
| Ec | 0.003 |
| Ei | 0.458 |
| Respiratory | 0.019 |
| Bcf | 4.126 |
| Igc50 | 5.58 |
| Lc50 | 7.816 |
| Lc50dm | 7.064 |
| Nr-ar | 0.103 |
| Nr-ar-lbd | 0.475 |
| Nr-ahr | 0.877 |
| Nr-aromatase | 0.83 |
| Nr-er | 0.427 |
| Nr-er-lbd | 0.242 |
| Nr-ppar-gamma | 0.739 |
| Sr-are | 0.88 |
| Sr-atad5 | 0.045 |
| Sr-hse | 0.57 |
| Sr-mmp | 0.927 |
| Sr-p53 | 0.913 |
| Vol | 435.008 |
| Dense | 1.076 |
| Flex | 0.16 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.303 |
| Synth | 2.351 |
| Fsp3 | 0 |
| Mce-18 | 23 |
| Natural product-likeness | -1.425 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |