| General Information | |
|---|---|
| ZINC ID | ZINC000028902908 |
| Molecular Weight (Da) | 486 |
| SMILES | N#Cc1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)nc1Oc1ccc(Cl)cc1 |
| Molecular Formula | C24Cl4N2O1 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 125.313 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| LogP | 8.783 |
| Activity (Ki) in nM | 4168.694 |
| Polar Surface Area (PSA) | 45.91 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.128 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 24 |
| Fraction csp3 | 0 |
| Ilogp | 4.22 |
| Xlogp3 | 8.23 |
| Wlogp | 8.69 |
| Mlogp | 5.76 |
| Silicos-it log p | 8.16 |
| Consensus log p | 7.01 |
| Esol log s | -8.35 |
| Esol solubility (mg/ml) | 0.00000218 |
| Esol solubility (mol/l) | 4.49E-09 |
| Esol class | Poorly sol |
| Ali log s | -9.06 |
| Ali solubility (mg/ml) | 0.00000042 |
| Ali solubility (mol/l) | 8.80E-10 |
| Ali class | Poorly sol |
| Silicos-it logsw | -11.7 |
| Silicos-it solubility (mg/ml) | 9.63E-10 |
| Silicos-it solubility (mol/l) | 1.98E-12 |
| Silicos-it class | Insoluble |
| Pgp substrate | |
| Log kp (cm/s) | -3.42 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 2 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.35 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.987 |
| Logd | 4.027 |
| Logp | 7.344 |
| F (20%) | 0.01 |
| F (30%) | 0.047 |
| Mdck | 7.15E-06 |
| Ppb | 1.0498 |
| Vdss | 0.348 |
| Fu | 0.0066 |
| Cyp1a2-inh | 0.9 |
| Cyp1a2-sub | 0.182 |
| Cyp2c19-inh | 0.746 |
| Cyp2c19-sub | 0.053 |
| Cl | 6.271 |
| T12 | 0.012 |
| H-ht | 0.276 |
| Dili | 0.954 |
| Roa | 0.228 |
| Fdamdd | 0.602 |
| Skinsen | 0.04 |
| Ec | 0.003 |
| Ei | 0.475 |
| Respiratory | 0.015 |
| Bcf | 4.384 |
| Igc50 | 5.672 |
| Lc50 | 7.999 |
| Lc50dm | 6.755 |
| Nr-ar | 0.222 |
| Nr-ar-lbd | 0.295 |
| Nr-ahr | 0.847 |
| Nr-aromatase | 0.826 |
| Nr-er | 0.523 |
| Nr-er-lbd | 0.728 |
| Nr-ppar-gamma | 0.428 |
| Sr-are | 0.927 |
| Sr-atad5 | 0.321 |
| Sr-hse | 0.558 |
| Sr-mmp | 0.952 |
| Sr-p53 | 0.928 |
| Vol | 444.152 |
| Dense | 1.09 |
| Flex | 0.16 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.29 |
| Synth | 2.29 |
| Fsp3 | 0 |
| Mce-18 | 23 |
| Natural product-likeness | -1.019 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |