| General Information | |
|---|---|
| ZINC ID | ZINC000028902986 |
| Molecular Weight (Da) | 443 |
| SMILES | N#Cc1cc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)nc1N1CCCCC1 |
| Molecular Formula | C23Cl3N3 |
| Action | Inverse Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 120.837 |
| HBA | 2 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| LogP | 7.638 |
| Activity (Ki) in nM | 3981.072 |
| Polar Surface Area (PSA) | 39.92 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 1.036 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 18 |
| Fraction csp3 | 0.22 |
| Ilogp | 4.05 |
| Xlogp3 | 7.04 |
| Wlogp | 6.86 |
| Mlogp | 5.04 |
| Silicos-it log p | 6.97 |
| Consensus log p | 5.99 |
| Esol log s | -7.28 |
| Esol solubility (mg/ml) | 0.0000231 |
| Esol solubility (mol/l) | 5.23E-08 |
| Esol class | Poorly sol |
| Ali log s | -7.69 |
| Ali solubility (mg/ml) | 0.00000894 |
| Ali solubility (mol/l) | 2.02E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -9.6 |
| Silicos-it solubility (mg/ml) | 0.00000011 |
| Silicos-it solubility (mol/l) | 2.51E-10 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.22 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -7.825 |
| Logd | 4.455 |
| Logp | 7.31 |
| F (20%) | 0.005 |
| F (30%) | 0.038 |
| Mdck | 5.51E-06 |
| Ppb | 1.0132 |
| Vdss | 0.848 |
| Fu | 0.0112 |
| Cyp1a2-inh | 0.908 |
| Cyp1a2-sub | 0.229 |
| Cyp2c19-inh | 0.814 |
| Cyp2c19-sub | 0.057 |
| Cl | 6.695 |
| T12 | 0.014 |
| H-ht | 0.919 |
| Dili | 0.938 |
| Roa | 0.805 |
| Fdamdd | 0.253 |
| Skinsen | 0.042 |
| Ec | 0.003 |
| Ei | 0.405 |
| Respiratory | 0.036 |
| Bcf | 3.829 |
| Igc50 | 5.452 |
| Lc50 | 7.148 |
| Lc50dm | 6.286 |
| Nr-ar | 0.073 |
| Nr-ar-lbd | 0.914 |
| Nr-ahr | 0.805 |
| Nr-aromatase | 0.78 |
| Nr-er | 0.597 |
| Nr-er-lbd | 0.649 |
| Nr-ppar-gamma | 0.932 |
| Sr-are | 0.951 |
| Sr-atad5 | 0.583 |
| Sr-hse | 0.846 |
| Sr-mmp | 0.933 |
| Sr-p53 | 0.983 |
| Vol | 421.761 |
| Dense | 1.046 |
| Flex | 0.12 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 1 |
| Surechembl | 0 |
| Nonbiodegradable | 2 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 0.429 |
| Synth | 2.304 |
| Fsp3 | 0.217 |
| Mce-18 | 51.857 |
| Natural product-likeness | -1.309 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Accepted |