| General Information | |
|---|---|
| ZINC ID | ZINC000028948296 |
| Molecular Weight (Da) | 351 |
| SMILES | CCSC(=O)N1CC(C)(C)CS/C1=Nc1ccccc1C(C)C |
| Molecular Formula | C18N2O1S2 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 102.388 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| LogP | 5.88 |
| Activity (Ki) in nM | 47.863 |
| Polar Surface Area (PSA) | 83.27 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | - |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.94076007 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 6 |
| Fraction csp3 | 0.56 |
| Ilogp | 3.71 |
| Xlogp3 | 5.69 |
| Wlogp | 5.36 |
| Mlogp | 4.1 |
| Silicos-it log p | 4.83 |
| Consensus log p | 4.74 |
| Esol log s | -5.46 |
| Esol solubility (mg/ml) | 1.21E-03 |
| Esol solubility (mol/l) | 3.46E-06 |
| Esol class | Moderately |
| Ali log s | -7.2 |
| Ali solubility (mg/ml) | 2.19E-05 |
| Ali solubility (mol/l) | 6.25E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -5.38 |
| Silicos-it solubility (mg/ml) | 1.45E-03 |
| Silicos-it solubility (mol/l) | 4.13E-06 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.4 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 2 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.86 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.537 |
| Logd | 5.11 |
| Logp | 4.988 |
| F (20%) | 0.002 |
| F (30%) | 0.001 |
| Mdck | 2.66E-05 |
| Ppb | 1.0077 |
| Vdss | 1.309 |
| Fu | 0.0184 |
| Cyp1a2-inh | 0.469 |
| Cyp1a2-sub | 0.931 |
| Cyp2c19-inh | 0.843 |
| Cyp2c19-sub | 0.926 |
| Cl | 5.064 |
| T12 | 0.04 |
| H-ht | 0.424 |
| Dili | 0.948 |
| Roa | 0.084 |
| Fdamdd | 0.053 |
| Skinsen | 0.847 |
| Ec | 0.012 |
| Ei | 0.434 |
| Respiratory | 0.942 |
| Bcf | 2.04 |
| Igc50 | 4.179 |
| Lc50 | 5.331 |
| Lc50dm | 6.281 |
| Nr-ar | 0.642 |
| Nr-ar-lbd | 0.005 |
| Nr-ahr | 0.579 |
| Nr-aromatase | 0.986 |
| Nr-er | 0.172 |
| Nr-er-lbd | 0.021 |
| Nr-ppar-gamma | 0.248 |
| Sr-are | 0.533 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.725 |
| Sr-mmp | 0.878 |
| Sr-p53 | 0.054 |
| Vol | 357.391 |
| Dense | 0.98 |
| Flex | 14 |
| Nstereo | 0.357 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 1 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 1 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 1 |
| Toxicophores | 1 |
| Qed | 3 |
| Synth | 0.696 |
| Fsp3 | 3.185 |
| Mce-18 | 0.556 |
| Natural product-likeness | 33.214 |
| Alarm nmr | -0.631 |
| Bms | 3 |
| Chelating | 0 |
| Pfizer | 1 |
| Gsk | Rejected |
| Goldentriangle | Rejected |