| General Information | |
|---|---|
| ZINC ID | ZINC000028954350 |
| Molecular Weight (Da) | 382 |
| SMILES | Cc1c(C(C)C)s/c(=NC(=O)c2cccc(C(F)(F)F)c2)n1CC1CC1 |
| Molecular Formula | C19F3N2O1S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 96.101 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| LogP | 6.306 |
| Activity (Ki) in nM | 28.84 |
| Polar Surface Area (PSA) | 62.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | + |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | - |
| Plasma protein binding | 0.97508323 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.47 |
| Ilogp | 4.09 |
| Xlogp3 | 5.3 |
| Wlogp | 6.24 |
| Mlogp | 3.93 |
| Silicos-it log p | 6.76 |
| Consensus log p | 5.26 |
| Esol log s | -5.47 |
| Esol solubility (mg/ml) | 1.30E-03 |
| Esol solubility (mol/l) | 3.41E-06 |
| Esol class | Moderately |
| Ali log s | -6.37 |
| Ali solubility (mg/ml) | 1.65E-04 |
| Ali solubility (mol/l) | 4.31E-07 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.02 |
| Silicos-it solubility (mg/ml) | 3.62E-04 |
| Silicos-it solubility (mol/l) | 9.46E-07 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.87 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.59 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -5.835 |
| Logd | 4.538 |
| Logp | 4.912 |
| F (20%) | 0.031 |
| F (30%) | 0.602 |
| Mdck | 1.13E-05 |
| Ppb | 0.9914 |
| Vdss | 2.384 |
| Fu | 0.0106 |
| Cyp1a2-inh | 0.539 |
| Cyp1a2-sub | 0.919 |
| Cyp2c19-inh | 0.9 |
| Cyp2c19-sub | 0.485 |
| Cl | 2.226 |
| T12 | 0.034 |
| H-ht | 0.654 |
| Dili | 0.488 |
| Roa | 0.194 |
| Fdamdd | 0.255 |
| Skinsen | 0.025 |
| Ec | 0.003 |
| Ei | 0.017 |
| Respiratory | 0.74 |
| Bcf | 2.217 |
| Igc50 | 4.054 |
| Lc50 | 5.602 |
| Lc50dm | 5.889 |
| Nr-ar | 0.03 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.056 |
| Nr-aromatase | 0.92 |
| Nr-er | 0.418 |
| Nr-er-lbd | 0.1 |
| Nr-ppar-gamma | 0.107 |
| Sr-are | 0.205 |
| Sr-atad5 | 0.003 |
| Sr-hse | 0.044 |
| Sr-mmp | 0.705 |
| Sr-p53 | 0.04 |
| Vol | 363.187 |
| Dense | 1.052 |
| Flex | 16 |
| Nstereo | 0.375 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 1 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 1 |
| Synth | 0.72 |
| Fsp3 | 2.742 |
| Mce-18 | 0.474 |
| Natural product-likeness | 46.5 |
| Alarm nmr | -1.77 |
| Bms | 3 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Rejected |