| General Information | |
|---|---|
| ZINC ID | ZINC000028954359 |
| Molecular Weight (Da) | 431 |
| SMILES | Cc1c(C(C)(C)C)s/c(=NC(=O)c2cc(C(F)(F)F)ccc2Cl)n1CC1CC1 |
| Molecular Formula | C20Cl1F3N2O1S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 105.304 |
| HBA | 1 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| LogP | 7.388 |
| Activity (Ki) in nM | 2.089 |
| Polar Surface Area (PSA) | 62.6 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | - |
| P-glycoprotein substrate | - |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | + |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | + |
| Androgen receptor binding | + |
| Plasma protein binding | 0.74282717 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 11 |
| Fraction csp3 | 0.5 |
| Ilogp | 4.23 |
| Xlogp3 | 6.47 |
| Wlogp | 7.07 |
| Mlogp | 4.63 |
| Silicos-it log p | 7.66 |
| Consensus log p | 6.01 |
| Esol log s | -6.48 |
| Esol solubility (mg/ml) | 0.000142 |
| Esol solubility (mol/l) | 0.00000032 |
| Esol class | Poorly sol |
| Ali log s | -7.58 |
| Ali solubility (mg/ml) | 0.0000113 |
| Ali solubility (mol/l) | 2.63E-08 |
| Ali class | Poorly sol |
| Silicos-it logsw | -6.98 |
| Silicos-it solubility (mg/ml) | 0.0000447 |
| Silicos-it solubility (mol/l) | 0.0000001 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -4.33 |
| Lipinski number of violations | 1 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 1 |
| Muegge number of violations | 1 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.75 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -6.755 |
| Logd | 4.554 |
| Logp | 5.839 |
| F (20%) | 0.665 |
| F (30%) | 0.876 |
| Mdck | 7.78E-06 |
| Ppb | 1.0079 |
| Vdss | 3.176 |
| Fu | 0.0143 |
| Cyp1a2-inh | 0.397 |
| Cyp1a2-sub | 0.91 |
| Cyp2c19-inh | 0.897 |
| Cyp2c19-sub | 0.496 |
| Cl | 2.624 |
| T12 | 0.011 |
| H-ht | 0.661 |
| Dili | 0.533 |
| Roa | 0.09 |
| Fdamdd | 0.807 |
| Skinsen | 0.03 |
| Ec | 0.003 |
| Ei | 0.014 |
| Respiratory | 0.569 |
| Bcf | 2.957 |
| Igc50 | 4.494 |
| Lc50 | 6.432 |
| Lc50dm | 6.34 |
| Nr-ar | 0.021 |
| Nr-ar-lbd | 0.009 |
| Nr-ahr | 0.246 |
| Nr-aromatase | 0.931 |
| Nr-er | 0.569 |
| Nr-er-lbd | 0.18 |
| Nr-ppar-gamma | 0.664 |
| Sr-are | 0.713 |
| Sr-atad5 | 0.002 |
| Sr-hse | 0.051 |
| Sr-mmp | 0.924 |
| Sr-p53 | 0.242 |
| Vol | 395.695 |
| Dense | 1.087 |
| Flex | 0.375 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 1 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 4 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 3 |
| Toxicophores | 1 |
| Qed | 0.589 |
| Synth | 2.78 |
| Fsp3 | 0.5 |
| Mce-18 | 52.8 |
| Natural product-likeness | -1.741 |
| Alarm nmr | 3 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 3 |
| Gsk | Rejected |
| Goldentriangle | Accepted |