| General Information | |
|---|---|
| ZINC ID | ZINC000028955263 |
| Molecular Weight (Da) | 430 |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)N4CCCCC4)ccc31)CN(C1CCCC1)C2 |
| Molecular Formula | C23N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 116.965 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| LogP | 3.801 |
| Activity (Ki) in nM | 812.831 |
| Polar Surface Area (PSA) | 71 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.27766513 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.61 |
| Ilogp | 3.99 |
| Xlogp3 | 3.06 |
| Wlogp | 3.74 |
| Mlogp | 3.43 |
| Silicos-it log p | 2.63 |
| Consensus log p | 3.37 |
| Esol log s | -4.32 |
| Esol solubility (mg/ml) | 0.0204 |
| Esol solubility (mol/l) | 0.0000475 |
| Esol class | Moderately |
| Ali log s | -4.22 |
| Ali solubility (mg/ml) | 0.026 |
| Ali solubility (mol/l) | 0.0000606 |
| Ali class | Moderately |
| Silicos-it logsw | -4.79 |
| Silicos-it solubility (mg/ml) | 0.007 |
| Silicos-it solubility (mol/l) | 0.0000163 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.75 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 0 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.02 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -3.84 |
| Logd | 3.269 |
| Logp | 3.581 |
| F (20%) | 0.063 |
| F (30%) | 0.025 |
| Mdck | - |
| Ppb | 54.69% |
| Vdss | 1.918 |
| Fu | 55.66% |
| Cyp1a2-inh | 0.083 |
| Cyp1a2-sub | 0.621 |
| Cyp2c19-inh | 0.366 |
| Cyp2c19-sub | 0.612 |
| Cl | 4.733 |
| T12 | 0.256 |
| H-ht | 0.971 |
| Dili | 0.854 |
| Roa | 0.141 |
| Fdamdd | 0.942 |
| Skinsen | 0.139 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.307 |
| Bcf | 1.071 |
| Igc50 | 4.264 |
| Lc50 | 5.216 |
| Lc50dm | 3.954 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.004 |
| Nr-ahr | 0.206 |
| Nr-aromatase | 0.858 |
| Nr-er | 0.149 |
| Nr-er-lbd | 0.726 |
| Nr-ppar-gamma | 0.221 |
| Sr-are | 0.593 |
| Sr-atad5 | 0.007 |
| Sr-hse | 0.736 |
| Sr-mmp | 0.271 |
| Sr-p53 | 0.763 |
| Vol | 428.27 |
| Dense | 1.002 |
| Flex | 0.179 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.743 |
| Synth | 2.711 |
| Fsp3 | 0.609 |
| Mce-18 | 74.162 |
| Natural product-likeness | -1.011 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |