| General Information | |
|---|---|
| ZINC ID | ZINC000028955359 |
| Molecular Weight (Da) | 460 |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN([C@H]1CCCCO1)C2 |
| Molecular Formula | C24N3O4S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 123.134 |
| HBA | 4 |
| HBD | 0 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| LogP | 3.378 |
| Activity (Ki) in nM | 6165.95 |
| Polar Surface Area (PSA) | 80.23 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | + |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | + |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | + |
| Cyp2c19 inhibition | - |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | + |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | - |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.41194742 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 9 |
| Fraction csp3 | 0.62 |
| Ilogp | 3.91 |
| Xlogp3 | 3.08 |
| Wlogp | 3.57 |
| Mlogp | 3.24 |
| Silicos-it log p | 2.34 |
| Consensus log p | 3.23 |
| Esol log s | -4.51 |
| Esol solubility (mg/ml) | 0.0143 |
| Esol solubility (mol/l) | 0.000031 |
| Esol class | Moderately |
| Ali log s | -4.43 |
| Ali solubility (mg/ml) | 0.017 |
| Ali solubility (mol/l) | 0.000037 |
| Ali class | Moderately |
| Silicos-it logsw | -4.66 |
| Silicos-it solubility (mg/ml) | 0.0101 |
| Silicos-it solubility (mol/l) | 0.0000221 |
| Silicos-it class | Moderately soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.92 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 1 |
| Synthetic accessibility | 4.79 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.431 |
| Logd | 3.244 |
| Logp | 3.598 |
| F (20%) | 0.025 |
| F (30%) | 0.025 |
| Mdck | - |
| Ppb | 51.27% |
| Vdss | 1.821 |
| Fu | 57.77% |
| Cyp1a2-inh | 0.046 |
| Cyp1a2-sub | 0.469 |
| Cyp2c19-inh | 0.27 |
| Cyp2c19-sub | 0.807 |
| Cl | 5.089 |
| T12 | 0.272 |
| H-ht | 0.984 |
| Dili | 0.875 |
| Roa | 0.613 |
| Fdamdd | 0.954 |
| Skinsen | 0.101 |
| Ec | 0.003 |
| Ei | 0.009 |
| Respiratory | 0.27 |
| Bcf | 1.177 |
| Igc50 | 3.996 |
| Lc50 | 4.823 |
| Lc50dm | 3.731 |
| Nr-ar | 0.002 |
| Nr-ar-lbd | 0.003 |
| Nr-ahr | 0.137 |
| Nr-aromatase | 0.578 |
| Nr-er | 0.146 |
| Nr-er-lbd | 0.73 |
| Nr-ppar-gamma | 0.061 |
| Sr-are | 0.656 |
| Sr-atad5 | 0.004 |
| Sr-hse | 0.663 |
| Sr-mmp | 0.226 |
| Sr-p53 | 0.831 |
| Vol | 454.356 |
| Dense | 1.011 |
| Flex | 0.172 |
| Nstereo | 1 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 1 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | - |
| Toxicophores | 2 |
| Qed | 0.699 |
| Synth | 3.417 |
| Fsp3 | 0.625 |
| Mce-18 | 104.846 |
| Natural product-likeness | -0.835 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | - |
| Gsk | Rejected |
| Goldentriangle | Accepted |