| General Information | |
|---|---|
| ZINC ID | ZINC000028955389 |
| Molecular Weight (Da) | 466 |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)N4CCC(C)CC4)ccc31)CN(Cc1ccccc1)C2 |
| Molecular Formula | C26N3O3S1 |
| Action | Agonist |
| Physicochemical Details | |
|---|---|
| Molar Refractivity | 129.714 |
| HBA | 3 |
| HBD | 0 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| LogP | 4.234 |
| Activity (Ki) in nM | 37.154 |
| Polar Surface Area (PSA) | 71 |
| Pharmacokinetic Properties (AdmetSAR) | |
|---|---|
| Human intestinal absorption | + |
| Caco-2 | - |
| Blood brain barrier | + |
| P-glycoprotein inhibitior | + |
| P-glycoprotein substrate | + |
| Cyp3a4 substrate | + |
| Cyp2c9 substrate | - |
| Cyp2d6 substrate | - |
| Cyp3a4 inhibition | + |
| Cyp2c9 inhibition | - |
| Cyp2c19 inhibition | + |
| Cyp2d6 inhibition | - |
| Cyp1a2 inhibition | - |
| Acute oral toxicity | - |
| Carcinogenicity (binary) | - |
| Ames mutagenesis | - |
| Human ether-a-go-go-related gene inhibition | + |
| Biodegradation | 0 |
| Glucocorticoid receptor binding | + |
| Thyroid receptor binding | - |
| Androgen receptor binding | + |
| Plasma protein binding | 0.51717048 |
| Pharmacokinetic Properties (SwissADME) | |
|---|---|
| Number of aromatic heavy atoms | 15 |
| Fraction csp3 | 0.42 |
| Ilogp | 3.82 |
| Xlogp3 | 3.72 |
| Wlogp | 4.09 |
| Mlogp | 3.83 |
| Silicos-it log p | 3.27 |
| Consensus log p | 3.75 |
| Esol log s | -5.01 |
| Esol solubility (mg/ml) | 0.00454 |
| Esol solubility (mol/l) | 0.00000976 |
| Esol class | Moderately |
| Ali log s | -4.9 |
| Ali solubility (mg/ml) | 0.00583 |
| Ali solubility (mol/l) | 0.0000125 |
| Ali class | Moderately |
| Silicos-it logsw | -6.67 |
| Silicos-it solubility (mg/ml) | 0.0000989 |
| Silicos-it solubility (mol/l) | 0.00000021 |
| Silicos-it class | Poorly soluble |
| Pgp substrate | |
| Log kp (cm/s) | -6.5 |
| Lipinski number of violations | 0 |
| Ghose number of violations | 1 |
| Veber number of violations | 0 |
| Egan number of violations | 0 |
| Muegge number of violations | 0 |
| Bioavailability score | 0.55 |
| Pains number of alerts | 0 |
| Brenk number of alerts | 0 |
| Leadlikeness number of violations | 2 |
| Synthetic accessibility | 3.69 |
| Pharmacokinetic Properties (ADMETLab) | |
|---|---|
| Logs | -4.608 |
| Logd | 3.786 |
| Logp | 4.11 |
| F (20%) | 0.008 |
| F (30%) | 0.018 |
| Mdck | 3.18E-05 |
| Ppb | 0.7523 |
| Vdss | 1.778 |
| Fu | 0.3392 |
| Cyp1a2-inh | 0.118 |
| Cyp1a2-sub | 0.24 |
| Cyp2c19-inh | 0.854 |
| Cyp2c19-sub | 0.571 |
| Cl | 6.419 |
| T12 | 0.227 |
| H-ht | 0.974 |
| Dili | 0.934 |
| Roa | 0.175 |
| Fdamdd | 0.935 |
| Skinsen | 0.082 |
| Ec | 0.003 |
| Ei | 0.01 |
| Respiratory | 0.134 |
| Bcf | 1.219 |
| Igc50 | 4.347 |
| Lc50 | 5.471 |
| Lc50dm | 4.109 |
| Nr-ar | 0.005 |
| Nr-ar-lbd | 0.008 |
| Nr-ahr | 0.182 |
| Nr-aromatase | 0.606 |
| Nr-er | 0.188 |
| Nr-er-lbd | 0.849 |
| Nr-ppar-gamma | 0.217 |
| Sr-are | 0.535 |
| Sr-atad5 | 0.019 |
| Sr-hse | 0.525 |
| Sr-mmp | 0.187 |
| Sr-p53 | 0.653 |
| Vol | 472.248 |
| Dense | 0.985 |
| Flex | 0.207 |
| Nstereo | 0 |
| Nongenotoxic carcinogenicity | 0 |
| Ld50 oral | 0 |
| Genotoxic carcinogenicity mutagenicity | 0 |
| Surechembl | 0 |
| Nonbiodegradable | 0 |
| Skin sensitization | 0 |
| Acute aquatic toxicity | 0 |
| Toxicophores | 2 |
| Qed | 0.566 |
| Synth | 2.6 |
| Fsp3 | 0.423 |
| Mce-18 | 68.973 |
| Natural product-likeness | -1.217 |
| Alarm nmr | 1 |
| Bms | 0 |
| Chelating | 0 |
| Pfizer | 0 |
| Gsk | Rejected |
| Goldentriangle | Accepted |